|
|
| | TRIS(DIMETHYLAMINO)METHANE Basic information |
| Product Name: | TRIS(DIMETHYLAMINO)METHANE | | Synonyms: | N,N,N',N',N'',N''-HEXAMETHYLMETHANETRIAMINE;N,N,N,N,N,N-HEXAMETHYLMETHANETRIAMINE;TRIS(DIMETHYLAMINO)METHANE;N,N',N''-Methylidynetris(dimethylamine);Tris(dimethylamino)methane,85%;N,N,N',N',N'',N''-Hexamethylmethanetriamine 90%;Tris(diMethylaMino)Methane, 85% 5GR;Tris(N,N-dimethylamino)methane | | CAS: | 5762-56-1 | | MF: | C7H19N3 | | MW: | 145.25 | | EINECS: | 227-284-0 | | Product Categories: | Building Blocks;Chemical Synthesis;Nitrogen Compounds;Organic Building Blocks;Aliphatics;Nitrogen Compounds;Organic Building Blocks;Polyamines | | Mol File: | 5762-56-1.mol |  |
| | TRIS(DIMETHYLAMINO)METHANE Chemical Properties |
| Boiling point | 42-43 °C/12 mmHg (lit.) | | density | 0.838 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.436(lit.) | | Fp | 4 °F | | storage temp. | 2-8°C | | pka | 6.50±0.38(Predicted) | | form | Liquid | | color | Clear colorless to slightly yellow | | BRN | 1901162 | | InChI | InChI=1S/C7H19N3/c1-8(2)7(9(3)4)10(5)6/h7H,1-6H3 | | InChIKey | MUMVIYLVHVCYGI-UHFFFAOYSA-N | | SMILES | C(N(C)C)(N(C)C)N(C)C |
| Hazard Codes | F,C | | Risk Statements | 11-34 | | Safety Statements | 16-26-36/37/39-45 | | RIDADR | UN 2733 3/PG 2 | | WGK Germany | 3 | | F | 3-8-10-21 | | Hazard Note | Corrosive/Highly Flammable | | HazardClass | 3.1 | | PackingGroup | II | | HS Code | 29212900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 Skin Corr. 1B |
| | TRIS(DIMETHYLAMINO)METHANE Usage And Synthesis |
| Chemical Properties | Clear colorless to slightly yellow liquid | | Uses | Reagent for the introduction of the dimethylaminoethylidene group.1 General review;2 RO polymerization of lactide.3 | | Uses | N,N,N'',N'',N'''',N''''-Hexamethylmethanetriamine, can be used in the synthesis of the phosphoramidite derivative of the new nucleoside analog. It can also be used as reagent for the introduction of the dimethylaminoethylidene group. | | Uses | Tris(dimethylamino)methane was used:
- to prepare the phosphoramidite derivative of the new nucleoside analog
- as reagent for the introduction of the dimethylaminoethylidene group
- in ring-opening (RO) polymerization of lactide
| | General Description | NMR spectra and their temperature-dependence has been reported for tris(dimethylamino)methane. Tris(dimethylamino)methane reacts with crowded α-(o-nitrophenyl) ketone to yield tetrahydroquinoline derivative. | | Purification Methods | Dry it over KOH and distil it through a Vigreux column (p 11) at water pump vacuum. Store it in the absence of CO2. [Bredereck et al. Chem Ber 101 1885 1968 and Angew Chem, Int Ed Engl 5 132 1966.] |
| | TRIS(DIMETHYLAMINO)METHANE Preparation Products And Raw materials |
|