|
|
| | trans-4-Pentylcyclohexanecarboxylic acid Basic information |
| | trans-4-Pentylcyclohexanecarboxylic acid Chemical Properties |
| Melting point | 51-53 °C (lit.) | | Boiling point | 295.63°C (rough estimate) | | density | 0.9590 (rough estimate) | | refractive index | 1.4720 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Methanol | | pka | 4.94±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C12H22O2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h10-11H,2-9H2,1H3,(H,13,14)/t10-,11- | | InChIKey | RVLAXPQGTRTHEV-XYPYZODXSA-N | | SMILES | CCCCC[C@@H]1CC[C@H](CC1)C(O)=O | | CAS DataBase Reference | 38289-29-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 29162090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | trans-4-Pentylcyclohexanecarboxylic acid Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | trans-4-Pentylcyclohexanecarboxylic acid has been used in preparation of:
- 4-[(2-(trans-4-pentylcyclohexyl)ethyl]phenol
- 4-[(4-trans-pentyl-cyclohexanecarbonyl)-(4-pyridin-4-yl-benzyl)-amino]-piperidine-1-tert-butyl carbamate
- 2-cyano-1-benzofuran-5-yl trans-4-pentylcyclohexanecarboxylate
| | Uses | Intermediates of Liquid Crystals | | Synthesis | trans-4-Pentylcyclohexanecarboxylic acid was prepared by using methyl 4-pentylbenzoate as the starting material, and 4-pentylbenzoic acid was produced by alkaline hydrolysis, and then trans-4-pentylcyclohexanecarboxylic acid with high purity was prepared by the hydrogenation reaction of the aromatic ring and crystallization and separation. |
| | trans-4-Pentylcyclohexanecarboxylic acid Preparation Products And Raw materials |
|