|
|
| | ethyl 1,3-dimethyl-1H-1,2,4-triazole-5-carboxylate Basic information |
| Product Name: | ethyl 1,3-dimethyl-1H-1,2,4-triazole-5-carboxylate | | Synonyms: | ethyl 1,3-dimethyl-1H-1,2,4-triazole-5-carboxylate;1H-1,2,4-Triazole-5-carboxylic acid, 1,3-dimethyl-, ethyl ester | | CAS: | 1343048-89-4 | | MF: | C7H11N3O2 | | MW: | 169.18 | | EINECS: | | | Product Categories: | | | Mol File: | 1343048-89-4.mol |  |
| | ethyl 1,3-dimethyl-1H-1,2,4-triazole-5-carboxylate Chemical Properties |
| Boiling point | 301.1±25.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | pka | 1.95±0.10(Predicted) | | InChI | InChI=1S/C7H11N3O2/c1-4-12-7(11)6-8-5(2)9-10(6)3/h4H2,1-3H3 | | InChIKey | VCYYMPFMOTUVNW-UHFFFAOYSA-N | | SMILES | N1(C)C(C(OCC)=O)=NC(C)=N1 |
| | ethyl 1,3-dimethyl-1H-1,2,4-triazole-5-carboxylate Usage And Synthesis |
| | ethyl 1,3-dimethyl-1H-1,2,4-triazole-5-carboxylate Preparation Products And Raw materials |
|