|
|
| | N,N'-(3-Fluoro-4-methyl-8-oxo-5,6,7,8-tetrahydronaphthalene-1,7-diyl)diacetamide Basic information |
| Product Name: | N,N'-(3-Fluoro-4-methyl-8-oxo-5,6,7,8-tetrahydronaphthalene-1,7-diyl)diacetamide | | Synonyms: | N,N'-(3-Fluoro-4-methyl-8-oxo-5,6,7,8-tetrahydronaphthalene-1,7-diyl)diacetamide;Acetamide, N,N'-(3-fluoro-5,6,7,8-tetrahydro-4-methyl-8-oxo-1,7-naphthalenediyl)bis- (9CI);Exatecan Intermediate 5;Exatecan Impurity 8 | | CAS: | 143655-70-3 | | MF: | C15H17FN2O3 | | MW: | 292.31 | | EINECS: | | | Product Categories: | | | Mol File: | 143655-70-3.mol |  |
| | N,N'-(3-Fluoro-4-methyl-8-oxo-5,6,7,8-tetrahydronaphthalene-1,7-diyl)diacetamide Chemical Properties |
| Boiling point | 596.8±50.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 13.55±0.40(Predicted) | | form | Solid | | color | Off-white to gray | | InChI | InChI=1S/C15H17FN2O3/c1-7-10-4-5-12(17-8(2)19)15(21)14(10)13(6-11(7)16)18-9(3)20/h6,12H,4-5H2,1-3H3,(H,17,19)(H,18,20) | | InChIKey | UNQLSBJKEGXCGH-UHFFFAOYSA-N | | SMILES | C1(NC(=O)C)=C2C(CCC(NC(=O)C)C2=O)=C(C)C(F)=C1 |
| | N,N'-(3-Fluoro-4-methyl-8-oxo-5,6,7,8-tetrahydronaphthalene-1,7-diyl)diacetamide Usage And Synthesis |
| Uses | Exatecan Intermediate 5 is the intermediate of Exatecan (HY-13631) And Exatecan (DX-8951) is a DNA topoisomerase I inhibitor with an IC50 value of 2.2 μM (0.975 μg/mL) that can be used in cancer research. Exatecan Intermediate 5 can be used to synthesize Antibody-Drug Conjugates (ADCs). | | IC 50 | Camptothecins | | References | [1] Xu, et al. Preparation of exatecan intermediate and its application. China, CN115701419 A. 2023-02-10.
[2] Mitsui I, et al. A new water-soluble camptothecin derivative, DX-8951f, exhibits potent antitumor activity against human tumors in vitro and in vivo. Jpn J Cancer Res. 1995 Aug;86(8):776-82. DOI:10.1111/j.1349-7006.1995.tb02468.x |
| | N,N'-(3-Fluoro-4-methyl-8-oxo-5,6,7,8-tetrahydronaphthalene-1,7-diyl)diacetamide Preparation Products And Raw materials |
|