|
|
| | 6-Chloropyridazine-3-carboxylic acid Basic information |
| | 6-Chloropyridazine-3-carboxylic acid Chemical Properties |
| Melting point | 146 °C | | Boiling point | 429.0±25.0 °C(Predicted) | | density | 1.579±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | pka | 2.68±0.10(Predicted) | | color | White to cream | | InChI | InChI=1S/C5H3ClN2O2/c6-4-2-1-3(5(9)10)7-8-4/h1-2H,(H,9,10) | | InChIKey | HHGZQZULOHYEOH-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NN=C(Cl)C=C1 | | CAS DataBase Reference | 5096-73-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 29339980 |
| | 6-Chloropyridazine-3-carboxylic acid Usage And Synthesis |
| Chemical Properties | 6-Chloropyridazine-3-carboxylic acid is Brown green powder | | Uses | 6-Chloropyridazine-3-carboxylic acid is a pyradazine derivative used in the preparation of stearoyl-CoA desaturase inhibitors. | | Synthesis | General procedure for the synthesis of 6-chloropyridazine-3-carboxylic acid from ethyl 6-chloropyridazine-3-carboxylate:
(Step-1) To a solution of ethyl 6-chloropyridazine-3-carboxylate (1.00 g, 5.36 mmol) in tetrahydrofuran (THF, 10 mL) was added a solution of lithium hydroxide (LiOH, 0.655 g, 26.8 mmol, 5 equiv) in water (10 mL). The reaction mixture was stirred at room temperature for 45 minutes. Upon completion of the reaction, the mixture was poured into 2 M hydrochloric acid and extracted with dichloromethane (DCM). The organic phases were combined and concentrated under reduced pressure to give 6-chloropyridazine-3-carboxylic acid as a white solid (770 mg, 91% yield).LC-MS (positive ESI): m/z 159/161 [M+H]+. | | References | [1] Patent: WO2015/67701, 2015, A1. Location in patent: Page/Page column 44 |
| | 6-Chloropyridazine-3-carboxylic acid Preparation Products And Raw materials |
|