| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
P18IN011 manufacturers
- P18IN011
-
- $80.00
-
2026-05-11
- CAS:77408-67-4
- Purity: 98.94%
- Supply Ability: 10g
|
| | P18IN011 Basic information |
| Product Name: | P18IN011 | | Synonyms: | P18IN011 - CAS 77408-67-4 - Calbiochem;1,2-benzoxazol-3-yl 4-acetamidobenzene-1-sulfonate;P18IN011;P18IN011,P-18IN011;Benzenesulfonic acid, 4-(acetylamino)-, 1,2-benzisoxazol-3-yl ester;P18IN011, 10 mM in DMSO | | CAS: | 77408-67-4 | | MF: | C15H12N2O5S | | MW: | 332.33 | | EINECS: | | | Product Categories: | | | Mol File: | 77408-67-4.mol |  |
| | P18IN011 Chemical Properties |
| Melting point | 143-144 °C(Solv: ethanol (64-17-5); water (7732-18-5)) | | Boiling point | 609.3±51.0 °C(Predicted) | | density | 1.468±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 50mg/mL | | pka | 13.85±0.70(Predicted) | | form | solid | | color | white | | InChI | 1S/C15H12N2O5S/c1-10(18)16-11-6-8-12(9-7-11)23(19,20)22-15-13-4-2-3-5-14(13)21-17-15/h2-9H,1H3,(H,16,18) | | InChIKey | SIXNKGXJEIVCDH-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(Oc2n[o]c3c2cccc3)c1ccc(cc1)NC(=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | P18IN011 Usage And Synthesis |
| Uses | A cell-permeable benzoxazolyl-acetamidobenzenesulfonate compound that directly interacts with p18 protein and blocks its activity. Specifically disrupts p18-Cdk6 complex formation with no effect on p16-Cdk6 interaction. Shown to significantly expand HSCs long-term repopulating ability by ~4.2-fold and increase the frequency with an ED50 of 5.70 µM. Suggested to exert little influence through cell proliferation and apoptosis.
Please note that the molecular weight for this compound is batch-specific due to variable water content. Please refer to the vial label or the certificate of analysis for the batch-specific molecular weight. The molecular weight provided represents the baseline molecular weight without water. | | Biological Activity | Cell permeable: yes', 'Primary Target
p18', 'Reversible: yes |
| | P18IN011 Preparation Products And Raw materials |
|