|
|
| | 2',5'-Dichloroacetophenone Basic information |
| Product Name: | 2',5'-Dichloroacetophenone | | Synonyms: | 1-(2,5-DICHLOROPHENYL)ETHANONE;2,5-DICHLOROACETOPHENONE;1-(2,5-dichlorophenyl)-ethanon;Acetophenone, 2',5'-dichloro-;Ethanone, 1-(2,5-dichlorophenyl)-;2',5'-Dichloroacetophenone 1-(2,5-Dichlorophenyl)ethanone;1-(2,5-Dichlorophenyl)ethan-1-one;Methyl 2,5-dichlorophenyl ketone | | CAS: | 2476-37-1 | | MF: | C8H6Cl2O | | MW: | 189.04 | | EINECS: | 219-605-8 | | Product Categories: | Aromatic Acetophenones & Derivatives (substituted);Carbonyl Compounds;Halides;Adehydes, Acetals & Ketones;Chlorine Compounds;C7 to C8;Carbonyl Compounds;Ketones;Acetophenone Series | | Mol File: | 2476-37-1.mol |  |
| | 2',5'-Dichloroacetophenone Chemical Properties |
| Melting point | 11-13 °C(lit.) | | Boiling point | 118 °C (12 mmHg) | | density | 1.312 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5624(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Clear yellow to brownish | | Specific Gravity | 1.312 | | BRN | 1865043 | | InChI | InChI=1S/C8H6Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4H,1H3 | | InChIKey | CYNFEPKQDJHIMV-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(Cl)=CC=C1Cl)C | | CAS DataBase Reference | 2476-37-1(CAS DataBase Reference) | | NIST Chemistry Reference | 2,5-Dichloroacetophenone(2476-37-1) | | EPA Substance Registry System | Ethanone, 1-(2,5-dichlorophenyl)- (2476-37-1) |
| Hazard Codes | Xi | | Risk Statements | 36/38-36/37/38 | | Safety Statements | 24/25-36-26-37-23 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29147000 | | Storage Class | 10 - Combustible liquids |
| | 2',5'-Dichloroacetophenone Usage And Synthesis |
| Chemical Properties | clear yellow to brownish liquid | | Uses | 2′,5′-Dichloroacetophenone was used in the synthesis of 5-chloro-2-(2-thienylthio)acetophenone. | | General Description | The standard molar enthalpy of formation of 2′,5′-dichloroacetophenone in the condensed phase was studied. | | Synthesis | 2,5-Dichloroacetophenone is an organic intermediate that can be obtained from 1,4-dichlorobenzene by the Foucault reaction.2,5-Dichloroacetophenone can be used in the preparation of 2,5-dichlorophenol.
|
| | 2',5'-Dichloroacetophenone Preparation Products And Raw materials |
|