- D-Tryptophanol
-
- $0.00 / 1KG
-
2026-01-05
- CAS:52485-52-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
- D-Tryptophanol
-
- $0.00 / 1KG
-
2025-04-04
- CAS:52485-52-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1Ton
- d-tyr-ol
-
- $1.00 / 1g
-
2020-01-06
- CAS:52485-52-6
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | D-Tryptophanol Basic information |
| | D-Tryptophanol Chemical Properties |
| Melting point | 86-89 °C (lit.) | | alpha | -20.5 º (c=1 in methanol) | | Boiling point | 444.2±30.0 °C(Predicted) | | density | 1.245±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 12.85±0.10(Predicted) | | form | Powder | | Appearance | Light yellow to brown Solid | | Optical Rotation | [α]20/D +18.5°, c = 1 in methanol | | Major Application | peptide synthesis | | InChI | InChI=1/C11H14N2O/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11/h1-4,6,9,13-14H,5,7,12H2/t9-/s3 | | InChIKey | UDQCRUSSQAXPJY-DJEYLCQNNA-N | | SMILES | C12C=CC=CC=1NC=C2C[C@@H](N)CO |&1:10,r| | | CAS DataBase Reference | 52485-52-6(CAS DataBase Reference) |
| | D-Tryptophanol Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | D-Tryptophanol Preparation Products And Raw materials |
|