|
|
| | Clavulanic acid Impurity 1 Basic information |
| Product Name: | Clavulanic acid Impurity 1 | | Synonyms: | Clavulanic acid Impurity 1;potassium (3R,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate;Clavulanate Potassium Impurity 16;Potassium Clavulanate Impurity 16;Clavulanate Potassium Impurity 11;(3R,5S)-7-Oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylic acid, potassium salt (Clavulanic acid Impurtiy);Clavulanic Acid Impurity 2 Potassium Salt;Clavulanic acid Impurity | | CAS: | 2196185-67-6 | | MF: | C6H8KNO4 | | MW: | 197.23 | | EINECS: | | | Product Categories: | | | Mol File: | 2196185-67-6.mol |  |
| | Clavulanic acid Impurity 1 Chemical Properties |
| InChI | InChI=1/C6H7NO4.K.H/c8-4-1-5-7(4)2-3(11-5)6(9)10;;/h3,5H,1-2H2,(H,9,10);;/t3-,5+;;/s3 | | InChIKey | UIQJXOXASYXODF-PMSOROBYNA-N | | SMILES | O=C1C[C@]2([H])O[C@@H](C(=O)O)CN12.[KH] |&1:3,6,r| |
| | Clavulanic acid Impurity 1 Usage And Synthesis |
| Uses | Clavam-2-carboxylate Potassium is an impurity in the synthesis of Clavulanic Acid (C563750), a β-lactamase inhibitor, typically added to amoxicillin to increase its effectiveness. |
| | Clavulanic acid Impurity 1 Preparation Products And Raw materials |
|