diSulfo-Cy5 amine manufacturers
- diSulfo-Cy5 amine
-
- $0.00 / 25mg
-
2025-06-07
- CAS:2183440-44-8
- Min. Order: 25mg
- Purity: >98.00%
- Supply Ability: 25mg
|
| | diSulfo-Cy5 amine Basic information |
| Product Name: | diSulfo-Cy5 amine | | Synonyms: | diSulfo-Cy5 amine;sulfo Cy5(Me) NH2.HCl;1-(6-((6-Aminohexyl)amino)-6-oxohexyl)-3,3-dimethyl-2-(5-(1,3,3-trimethyl-5-sulfoindolin-2-ylidene)penta-1,3-dien-1-yl)-3H-indol-1-ium-5-sulfonate;Sulfo Cy5(N-Me) NH2.HCl;Sulfo-Cy5 amine（Methyl) | | CAS: | 2183440-44-8 | | MF: | C38H52N4O7S2 | | MW: | 740.98 | | EINECS: | | | Product Categories: | | | Mol File: | 2183440-44-8.mol |  |
| | diSulfo-Cy5 amine Chemical Properties |
| storage temp. | 2-8°C, sealed storage, away from moisture and light | | solubility | Soluble in water, DMF, DMSO, alcohols | | form | Solid | | color | Brown to reddish brown | | Appearance | Dark blue solid | | ε(extinction coefficient) | 271000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.28 | | ex/em | 649/672 nm (PBS buffer) | | InChIKey | YAAUASLQACUDFY-UHFFFAOYSA-N | | SMILES | C([N+]1=C(C(C)(C)C2=CC(S([O-])(=O)=O)=CC=C12)C=CC=CC=C1N(C2=CC=C(S(O)(=O)=O)C=C2C1(C)C)C)CCCCC(=O)NCCCCCCN |
| | diSulfo-Cy5 amine Usage And Synthesis |
| Description | Sulfo-Cy5 amine is a water-soluble dye that reacts with electrophilic substances and is very photostable. The addition of the amine group makes the compound reactive towards carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. | | Chemical Properties | Appearance: Dark blue solid
ex/em: 649/672 nm (PBS buffer)
Extinction coefficient (ε): 271000 L??mol??1??cm??1
Quantum yield (Φ): 0.28 | | Uses | Sulfo-Cy5 amine is a dye derivative of Cyanine 5 (Cy5) (HY-D0821) bearing an amine group. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy5 is a near-infrared fluorescent dye commonly used in biolabeling and cell imaging. The amine functionality of Sulfo-Cy5 amine can react with carboxyl groups to form covalent bonds. Sulfo-Cy5 amine can bind to biomolecules such as proteins and antibodies to track their location and dynamic changes in biological samples. | | Abs/Em Maxima | 646/662 nm | | Fluoresene quantum yield | 0.28 | | Extinction Coefficient | 271000 | | CF260 | 0.04 | | CF280 | 0.04 |
| | diSulfo-Cy5 amine Preparation Products And Raw materials |
|