|
|
| | (1R,2R)-N,N'-Dimethyl-1,2-cyclohexanediamine Basic information |
| Product Name: | (1R,2R)-N,N'-Dimethyl-1,2-cyclohexanediamine | | Synonyms: | (1R,2R)-(-)-N1,N2-Dimethylcyclohexane-1,2-diamine 95%;(1R,2R)-(-)-1,2-BIS(METHYLAMINO)CYCLOHEXANE;(1R,2R)-(-)-N,N'-DIMETHYLCYCLOHEXANE-1,2-DIAMINE;(1R,2R)-DIAMINOMETHYLCYCLOHEXANE;trans-1,2-Bis(methylamino)cyclohexane, (R,R)-(-)-N,Nμ-Dimethyl-1,2-diaminocyclohexane;(R,R)-(-)-N,N'-Dimethyl-1,2-cyclohexandiamine;(R,R)-1,2-Bis(methylamino)cyclohexane.;trans-(1R,2R)-N,N'-Bismethyl-1,2-cyclohexane | | CAS: | 68737-65-5 | | MF: | C8H18N2 | | MW: | 142.24 | | EINECS: | | | Product Categories: | Chiral Building Blocks;e.e. / Absolute Configuration Determination (NMR);Enantiomer Excess & Absolute Configuration Determination;Synthetic Organic Chemistry;Amines and Anilines;Amines (Chiral);Analytical Chemistry;chiral;Chiral Nitrogen;DACH&Trost Series | | Mol File: | 68737-65-5.mol |  |
| | (1R,2R)-N,N'-Dimethyl-1,2-cyclohexanediamine Chemical Properties |
| Melting point | 39-44 °C | | alpha | -145 º (c=4.47 in chloroform) | | Boiling point | 249.85°C (rough estimate) | | density | 0.902 | | refractive index | -140 ° (C=4, CHCl3) | | Fp | 74 °C | | storage temp. | 2-8°C | | form | Low Melting Solid | | pka | 11.04±0.40(Predicted) | | color | White to light yellow | | Optical Rotation | [α]/D -145±5°, c = 4.47 in chloroform | | InChI | InChI=1S/C8H18N2/c1-9-7-5-3-4-6-8(7)10-2/h7-10H,3-6H2,1-2H3/t7-,8-/m1/s1 | | InChIKey | JRHPOFJADXHYBR-HTQZYQBOSA-N | | SMILES | [C@@H]1(NC)CCCC[C@H]1NC | | CAS DataBase Reference | 68737-65-5(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-22 | | Safety Statements | 45-36/37/39-25-26 | | RIDADR | 3259 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | Ⅱ | | HS Code | 29213000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Provider | Language |
|
ACROS
| English |
| | (1R,2R)-N,N'-Dimethyl-1,2-cyclohexanediamine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (R,R)-()-N,N′-Dimethyl-1,2-cyclohexanediamine can be used:
- As a ligand in the preparation of 4H-benzo[f]imidazo[1,4]diazepin-6-one through multi-component Ullmann coupling reaction.
- In one of the key synthetic steps for the preparation of tricyclic γ-secretase modulators.
- To prepare chiral fluorous diamino-diol proligand, which is used in the synthesis of zirconium metal complexes applicable as catalysts in 1-hexene polymerization.
| | General Description | (R,R)-(-)-N,N′-Dimethyl-1,2-cyclohexanediamine is a N,N′-dimethylated derivative of enantiopure 1,2-diaminocyclohexane. It can be formed during the hydrolysis of (R3a,R7a)-1,3-(dimethyl)-2-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-1,3,2-benzodiazaphosphole 2-oxide using HCl-methanol. |
| | (1R,2R)-N,N'-Dimethyl-1,2-cyclohexanediamine Preparation Products And Raw materials |
|