|
|
| | (R)-(-)-3-CHLOROMANDELIC ACID Basic information |
| | (R)-(-)-3-CHLOROMANDELIC ACID Chemical Properties |
| Melting point | 100-104 °C(lit.) | | Boiling point | 348.2±27.0 °C(Predicted) | | density | 1.468 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly) | | form | Solid | | pka | 3.24±0.10(Predicted) | | color | White | | Optical Rotation | [α]30/D 124°, c = 3 in H2O | | InChI | 1S/C8H7ClO3/c9-6-3-1-2-5(4-6)7(10)8(11)12/h1-4,7,10H,(H,11,12)/t7-/m1/s1 | | InChIKey | SAMVPMGKGGLIPF-SSDOTTSWSA-N | | SMILES | O[C@@H](C(O)=O)c1cccc(Cl)c1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (R)-(-)-3-CHLOROMANDELIC ACID Usage And Synthesis |
| Uses | (R)-(-)-3-Chloromandelic Acid is a reagent used in asymmetric syntheses due to its chirality. Used in the synthesis of a fluorescent analog of phenytoin as an inhibitor of neuropathic pain. |
| | (R)-(-)-3-CHLOROMANDELIC ACID Preparation Products And Raw materials |
|