(4R,4'R)-4,4',5,5'-tetrahydro-4,4'-
bis(phenylmethyl)-2,2'-Bioxazole manufacturers
|
| | (4R,4'R)-4,4',5,5'-tetrahydro-4,4'-
bis(phenylmethyl)-2,2'-Bioxazole Basic information |
| Product Name: | (4R,4'R)-4,4',5,5'-tetrahydro-4,4'-
bis(phenylmethyl)-2,2'-Bioxazole | | Synonyms: | (4R,4'R)-4,4',5,5'-tetrahydro-4,4'-
bis(phenylmethyl)-2,2'-Bioxazole;(4R,4'R)-4,4'-DiBenzyl-4,4',5,5'-tetrahydro-2,2'-bioxazole;2,2'-Bioxazole, 4,4',5,5'-tetrahydro-4,4'-bis(phenylmethyl)-, [R-(R*,R*)]- (9CI);(R,R)-Bn-Bisbox;2,2'-Bis[(4R)-4-Benzyl-2-Oxazoline | | CAS: | 141362-76-7 | | MF: | C20H20N2O2 | | MW: | 320.39 | | EINECS: | | | Product Categories: | | | Mol File: | 141362-76-7.mol |  |
| | (4R,4'R)-4,4',5,5'-tetrahydro-4,4'-
bis(phenylmethyl)-2,2'-Bioxazole Chemical Properties |
| Boiling point | 449.3±28.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 3.89±0.70(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C20H20N2O2/c1-3-7-15(8-4-1)11-17-13-23-19(21-17)20-22-18(14-24-20)12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18-/m1/s1 | | InChIKey | OIEQQWQZUYZCRJ-QZTJIDSGSA-N | | SMILES | O1C[C@@H](CC2=CC=CC=C2)N=C1C1=N[C@H](CC2=CC=CC=C2)CO1 |
| | (4R,4'R)-4,4',5,5'-tetrahydro-4,4'-
bis(phenylmethyl)-2,2'-Bioxazole Usage And Synthesis |
| | (4R,4'R)-4,4',5,5'-tetrahydro-4,4'-
bis(phenylmethyl)-2,2'-Bioxazole Preparation Products And Raw materials |
|