|
|
| | Fmoc-Gly-Gly-Phe-OH Basic information |
| Product Name: | Fmoc-Gly-Gly-Phe-OH | | Synonyms: | (2S)-2-{2-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetamido]acetamido}-3-phenylpropanoic acid;N-Fmoc-glycyl-glycyl-L-phenylalanine;L-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]glycylglycyl-;Fmoc-Gly-Gly-Phe-OH;Fmoc-Gly-Gly-L-Phe;(S)-11-Benzyl-1-(9H-fluoren-9-yl)-3,6,9-trioxo-2-oxa-4,7,10-triazadodecan-12-oic acid;(2S)-2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]-3-phenylpropanoic acid;Fomc-Gly-Gly-Phe-OH | | CAS: | 160036-44-2 | | MF: | C28H27N3O6 | | MW: | 501.53 | | EINECS: | | | Product Categories: | Linker;ADCs Linkers;ADC LINKER | | Mol File: | 160036-44-2.mol |  |
| | Fmoc-Gly-Gly-Phe-OH Chemical Properties |
| Boiling point | 852.2±65.0 °C(Predicted) | | density | 1.315±0.06 g/cm3(Predicted) | | pka | 3.50±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | UFGUUZVZUIXKQZ-DEOSSOPVSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1)NC(=O)CNC(=O)CNC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | Fmoc-Gly-Gly-Phe-OH Usage And Synthesis |
| Description | Fmoc-Gly-Gly-Phe-OH is an Fmoc-protected glycine derivative with a carboxylate group at the α position and an amide group at the β position. It is a white solid that can be synthesized by the reaction of ethyl glycine with glyoxylic acid in a solvent such as chloroform. This compound can be used for proteomic research and solid-phase peptide synthesis technology. It has been used to study the binding of oxytocin to its receptor, which is important in regulating uterine contractions during labor.
| | Uses | Fmoc-Gly-Gly-Phe-OH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). | | IC 50 | Cleavable Linker | | storage | -20℃ 3 years powder; -80℃ 2 years in solvent |
| | Fmoc-Gly-Gly-Phe-OH Preparation Products And Raw materials |
|