|
|
| | 1,2,3,4-TETRAMETHYL-1,3-CYCLOPENTADIENE Basic information |
| Product Name: | 1,2,3,4-TETRAMETHYL-1,3-CYCLOPENTADIENE | | Synonyms: | 1,2,3,4-TETRAMETHYL-1,3-CYCLOPENTADIENE;1,2,3,4-TETRAMETHYLCYCLOPENTADIENE;TETRAMETHYLCYCLOPENTADIENE;tetramethylcyclopentadiene, mixed isomers;Tetramethylcyclopentadiene, mixed isomers, 90+%;1,2,3,4-Tetramethyl-1,3-cyclopentadiene,85%;Tetrmethylcyclopendadiene;1,2,3,4-Tetramethyl-1,3-cyclopentadiene ,93% | | CAS: | 4249-10-9 | | MF: | C9H14 | | MW: | 122.21 | | EINECS: | | | Product Categories: | Alkenes;Cyclic;Organic Building Blocks | | Mol File: | 4249-10-9.mol |  |
| | 1,2,3,4-TETRAMETHYL-1,3-CYCLOPENTADIENE Chemical Properties |
| Boiling point | 142 °C (lit.) | | density | 0.808 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.472(lit.) | | Fp | 108 °F | | storage temp. | Sealed in dry,2-8°C | | solubility | Not miscible mix with mater. | | form | Liquid | | Specific Gravity | 0.808 | | color | Light yellow | | Sensitive | Air & Moisture Sensitive | | InChI | InChI=1S/C9H14/c1-6-5-7(2)9(4)8(6)3/h5H2,1-4H3 | | InChIKey | VNPQQEYMXYCAEZ-UHFFFAOYSA-N | | SMILES | C1(C)CC(C)=C(C)C=1C |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 3295 3/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29021900 |
| | 1,2,3,4-TETRAMETHYL-1,3-CYCLOPENTADIENE Usage And Synthesis |
| Chemical Properties | light yellow liquid | | Uses | 1,2,3,4-Tetramethylcyclopenta-1,3-diene is an intermediate in the conversion of ethylene to polyenes | | Uses | 1,2,3,4-Tetramethyl-1,3-cyclopentadiene may be used as a starting material in the synthesis of 1,7,8,9-tetramethyl-4-oxa-tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. | | General Description | 1,2,3,4-Tetramethyl-1,3-cyclopentadiene is a tetra substituted 1,3-cyclopentadiene. It participates in the synthesis of resin-bound tetramethylcyclopentadienes. |
| | 1,2,3,4-TETRAMETHYL-1,3-CYCLOPENTADIENE Preparation Products And Raw materials |
|