|
|
| | (+)-NICOTINE-(+)-DI-P-TOLUOYL TARTRATE Basic information |
| Product Name: | (+)-NICOTINE-(+)-DI-P-TOLUOYL TARTRATE | | Synonyms: | Pyridine, 3-[(2R)-1-methyl-2-pyrrolidinyl]-;(r)-3-(1-methyl-2-pyrrolidinyl)pyridine;2’-beta-h-nicotine;(+)-NICOTINE-(+)-DI-P-TOLUOYL TARTRATE S YNTHETIC >99%;5-23-06-00064 (Beilstein Handbook Reference);2'bH-Nicotine (8CI);Pseudonicotine;Pyridine, 3-(1-methyl-2-pyrrolidinyl)-, (R)- | | CAS: | 25162-00-9 | | MF: | C10H14N2 | | MW: | 162.23 | | EINECS: | | | Product Categories: | Nicotine Derivatives | | Mol File: | 25162-00-9.mol |  |
| | (+)-NICOTINE-(+)-DI-P-TOLUOYL TARTRATE Chemical Properties |
| Boiling point | 60-65°C/0.1mmHg | | storage temp. | Hygroscopic, Refrigerator, Under Inert Atmosphere | | solubility | Chloroform (Slightly), Isopropanol (Slightly), Methanol (Slightly) | | form | Oil | | density | 1.032±0.06 g/cm3(Predicted) | | pKa | 8.00±0.50(Predicted) | | color | Colourless to Brown | | Stability: | Hygroscopic | | InChI | InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m1/s1 | | InChIKey | SNICXCGAKADSCV-SNVBAGLBSA-N | | SMILES | C1=NC=CC=C1[C@H]1CCCN1C |
| | (+)-NICOTINE-(+)-DI-P-TOLUOYL TARTRATE Usage And Synthesis |
| Chemical Properties | Colourless Liquid | | Uses | This is the unnatural isomer of Nicotine. | | Definition | ChEBI: The (R)-enantiomer of nicotine. |
| | (+)-NICOTINE-(+)-DI-P-TOLUOYL TARTRATE Preparation Products And Raw materials |
|