- NU6027
-
- $37.00
-
2026-05-11
- CAS:220036-08-8
- Purity: 99.85%
- Supply Ability: 10g
|
| | NU 6027 Basic information |
| Product Name: | NU 6027 | | Synonyms: | ATR/CDK Inhibitor, NU6027 - CAS 220036-08-8 - Calbiochem;NU6027;NU-6027;NU 6027;2,4-Pyrimidinediamine, 6-(cyclohexylmethoxy)-5-nitroso-;ATR/CDK Inhibitor, NU6027;2,6-DiaMino-4-(cyclohexylMethoxy)-5-nitrosopyriMidine;6-(cyclohexylmethoxy)-5-nitrosopyrimidine-2,4-diamine;NU 6027 USP/EP/BP;inhibit,Ataxia telangiectasia mutated,Cyclin dependent kinase,ATM/ATR,NU 6027,cytotoxicity,NU6027,Inhibitor,NU-6027,CDK2,cisplatin,hydroxyurea,ATR,CDK1,CDK,ATM and RAD3 related,cancer | | CAS: | 220036-08-8 | | MF: | C11H17N5O2 | | MW: | 251.29 | | EINECS: | | | Product Categories: | Inhibitors | | Mol File: | 220036-08-8.mol |  |
| | NU 6027 Chemical Properties |
| Melting point | 252.5-253.7 °C(lit.) | | Boiling point | 549.2±60.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 15 mg/mL | | pka | 2.52±0.10(Predicted) | | form | Reddish-purple powder | | color | lavender | | InChI | 1S/C11H17N5O2/c12-9-8(16-17)10(15-11(13)14-9)18-6-7-4-2-1-3-5-7/h7H,1-6H2,(H4,12,13,14,15) | | InChIKey | DGWXOLHKVGDQLN-UHFFFAOYSA-N | | SMILES | Nc1nc(c(c(n1)OCC2CCCCC2)N=O)N |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | NU 6027 Usage And Synthesis |
| Uses | NU6027 is a potent cyclin-dependent kinase (CDK) and Rad3-related kinase (ATR) inhibitor. NU6027 has been shown to inhibit tumor cell growth. NU6027 inhibits ATR, impairing G2/M arrest and homologous recombination thus increasing sensitivity to DNA-damaging agents and poly(ADP-ribose) polymerase (PARP) inhibitors | | target | CDK1 | | IC 50 | CDK1: 2.5 μM (Ki); CDK2: 1.3 μM (Ki); ATR |
| | NU 6027 Preparation Products And Raw materials |
|