L-KYNURENINE SULFATE manufacturers
|
| | L-KYNURENINE SULFATE Basic information |
| Product Name: | L-KYNURENINE SULFATE | | Synonyms: | (S)-2-Amino-4-(2-Aminophenyl)-4-Oxobutanoic Acid Compound With Sulfuric Acid;L-Kynurenine sulphate (salt) monohydrate;L-KYNURENINE SULFATE (SALT) MONOHYDRATE;L-2-AMINO-3-(2-AMINOBENZOYL)PROPIONIC ACID SULFATE SALT;L-KYNURENINESULPHATE;Benzenebutanoic acid, a,2-diaMino-g-oxo-, (aS)-, sulfate (1:1);L-Kynurenine sulfate salt crystalline;(S)-2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid compound with sulfuric acid (1:1) | | CAS: | 16055-80-4 | | MF: | C10H16N2O8S | | MW: | 324.30764 | | EINECS: | | | Product Categories: | | | Mol File: | 16055-80-4.mol |  |
| | L-KYNURENINE SULFATE Chemical Properties |
| Melting point | 196 °C (decomp) | | storage temp. | −20°C | | form | crystalline | | color | light yellow | | InChI | 1S/C10H12N2O3.H2O4S/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15;1-5(2,3)4/h1-4,8H,5,11-12H2,(H,14,15);(H2,1,2,3,4)/t8-;/m0./s1 | | InChIKey | KAXRWMOLNJZCEW-QRPNPIFTSA-N | | SMILES | OS(O)(=O)=O.N[C@@H](CC(=O)c1ccccc1N)C(O)=O |
| WGK Germany | 3 | | HS Code | 2922500090 | | Storage Class | 11 - Combustible Solids |
| | L-KYNURENINE SULFATE Usage And Synthesis |
| Uses | L-Kynurenine Sulfate is a tryptophan metabolite which is a precursor of kynurenic acid (K660500) and an antagonist of N-methyl-aspartate receptor. | | Biological Activity | L-Kynurenine (L-Kyn) is a precursor of kynurenic acid which is the only recognized endogenous excitatory amino acid receptor antagonist in the central nervous system. L-Kyn is known to be a pigment generating component in animals. In mammals, it modulates the transmission of glutamate neurotransmitter. It is also considered to be a sex-attracting pheromone in vertebrates.', 'L-Kynurenine is a key intermediate in the breakdown of L-tryptophan and the formation of nicotinamide adenine dinucleotide (NAD+) via the kynurenine pathway. L-kynurenine is involved in a variety of neurological processes and diseases. L-kynurenine is a substrate for kynureninase/kynurenine hydrolase; kynurenine 3-monooxygenase and kynurenine-oxoglutarate transaminase.', 'Key intermediate in the breakdown pathway of tryptophan. | | IC 50 | Human Endogenous Metabolite | | Purification Methods | Crystallise the sulfate from water by addition of EtOH. The (±)-sulfate has m 173o. [Beilstein 14 IV 2562.] |
| | L-KYNURENINE SULFATE Preparation Products And Raw materials |
|