- (1S)-(-)-α-Pinene
-
- $7.00 / 25g
-
2026-01-28
- CAS:7785-26-4
- Min. Order: 1g
- Purity: 0.98
- Supply Ability: 100kg
- (-)-α-Pinene
-
- $30.00 / 1g
-
2026-01-26
- CAS:7785-26-4
- Min. Order:
- Purity: 98.02%
- Supply Ability: 10g
- (1S)-(-)-alpha-Pinene
-
- $0.00 / 1KG
-
2025-06-27
- CAS:7785-26-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | (1S)-(-)-alpha-Pinene Basic information |
| | (1S)-(-)-alpha-Pinene Chemical Properties |
| Melting point | -64 °C(lit.) | | alpha | -41.5 º (c=neat) | | Boiling point | 156-158 °C(lit.) | | density | 0.874 g/mL at 25 °C | | vapor density | 4.7 (vs air) | | vapor pressure | ~3 mm Hg ( 20 °C) | | refractive index | n20/D 1.466 | | FEMA | 2902 | ALPHA-PINENE | | Fp | 90 °F | | storage temp. | Store at +2°C to +8°C. | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Liquid | | color | Clear colorless | | Odor | at 10.00 % in dipropylene glycol. sharp warm resinous fresh pine | | Odor Type | herbal | | Optical Rotation | [α]22/D 42°, neat | | biological source | Pinus spp. | | explosive limit | 0.8%(V) | | Water Solubility | INSOLUBLE | | Merck | 14,7445 | | JECFA Number | 1329 | | BRN | 1903790 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/t8-,9-/m0/s1 | | InChIKey | GRWFGVWFFZKLTI-UHFFFAOYSA-N | | SMILES | [C@@H]21C([C@@H](C2)C(=CC1)C)(C)C | | LogP | 4.48 at 37℃ | | CAS DataBase Reference | 7785-26-4(CAS DataBase Reference) | | NIST Chemistry Reference | (1s)-2,6,6-Trimethylbicyclo[3.1.1]hept-2-ene(7785-26-4) | | EPA Substance Registry System | 2-Pinene, (1S,5S)-(-)- (7785-26-4) |
| Hazard Codes | Xn,N,Xi | | Risk Statements | 10-36/37/38-43-50-65-51/53-20/21/22 | | Safety Statements | 26-36/37-61-16-60 | | RIDADR | UN 2368 3/PG 3 | | WGK Germany | 1 | | RTECS | DT 7000000 | | F | 10 | | Autoignition Temperature | 491 °F | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29021910 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 2 Asp. Tox. 1 Flam. Liq. 3 Skin Irrit. 2 |
| | (1S)-(-)-alpha-Pinene Usage And Synthesis |
| Chemical Properties | (1S)-(-)-alpha-Pinene is clear colourless liquid | | Uses | (1S)-(-)-alpha-Pinene is used in the preparation of hydroxy ketones such as hydroxycarvones. | | Uses | (1S)-(-)-α-Pinene is used in the preparation of hydroxy ketones such as hydroxycarvones. | | Definition | ChEBI: (-)-alpha-pinene is an alpha-pinene. It is an enantiomer of a (+)-alpha-pinene. | | General Description | α-Pinene is a monoterpene used in industries like fragrance, pharmaceuticals, flavor, and cosmetics. It is a major component of pine oil and turpentine oil. Isomerization of α-pinene yields industrially important compounds like camphene, limonene, and p-cymene. | | reaction suitability | reagent type: reductant | | Purification Methods | Purify as for 1R,5S--Pinene above. [Beilstein 5 III 366, 5 IV 455.] |
| | (1S)-(-)-alpha-Pinene Preparation Products And Raw materials |
| Raw materials | alpha-Pinene | | Preparation Products | 2,6-DIMETHYL-2,4,6-OCTATRIENE-->6,6-dimethyl-2-methylidene-norpinan-3-one-->(1S,2S,5S)-(-)-2-Hydroxy-3-pinanone-->(1R,2R,3S,5R)-(-)-2,3-Pinanediol-->Bicyclo[3.1.1]heptane-2,3-diol, 2,6,6-trimethyl-, [1R-(1α,2β,3β,5α)]- (9CI)-->(+)-(1R,2R,5R)--Ethyl [(2-Hydroxypinan-3-ylene)aMino]acetate |
|