| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(R)-(+)-AMinoglutethiMide
CAS:55511-44-9
Purity:97% Package:500MG
|
| Company Name: |
LGM Pharma
|
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
| Products Intro: |
Product Name:DexaMinoglutethiMide
CAS:55511-44-9
Purity:Typically NLT 98%
|
| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
info@syntechem.com |
| Products Intro: |
Product Name:(R)-3-(4-aMinophenyl)-3-ethylpiperidine-2,6-dione
CAS:55511-44-9
Purity:97% Package:1g;5g;25g;100g;250g;1kg;5kg;10kg;25kg Remarks:we offer low price custom synthesis and contract manufacturing
|
|
| | (R)-(+)-AMINOGLUTETHIMIDE 97 Basic information |
| | (R)-(+)-AMINOGLUTETHIMIDE 97 Chemical Properties |
| Melting point | 115.5-119.5 °C (lit.) | | Boiling point | 457.4±45.0 °C(Predicted) | | density | 1.173±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | Solid | | pka | 11.60±0.40(Predicted) | | color | Off-white to light yellow | | Optical Rotation | [α]20/D +160°, c = 1 in methanol | | InChI | 1S/C13H16N2O2/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/h3-6H,2,7-8,14H2,1H3,(H,15,16,17)/t13-/m1/s1 | | InChIKey | ROBVIMPUHSLWNV-CYBMUJFWSA-N | | SMILES | CC[C@@]1(CCC(=O)NC1=O)c2ccc(N)cc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(+)-AMINOGLUTETHIMIDE 97 Usage And Synthesis |
| Uses | (R)-(+)-Aminoglutethimide can be used:
- As a building block for the development of cephalosporin based prodrug for antibody-directed enzyme prodrug therapy (ADEPT).
- To prepare (R)-3-ethyl-3-(4-(3,4,5-trimethoxybenzylamino)phenyl)piperidine-2,6-dione by reacting with 3,4,5-trimethoxybenzylamine via deaminative coupling reaction.
- To synthesize (R)-2-fluoro-2-(4-methoxyphenyl)-N-(R)-(+)-aminoglutethimide by enantioselective α-fluorination.
| | Definition | ChEBI: The (3R)-enantiomer of aminoglutethimide. | | in vivo | (R)-(+)-Aminoglutethimide (5, 50 mg/kg; p.o.) eliminates within 48 hr into urine and feces, mostly in the form of metabolites[2].
(R)-(+)-Aminoglutethimide (1, 10, 50 mg/kg; i.p.; 60 min before training) dose not induce any significant effect in 1 and 10 mg/kg, induces a loss of retention at 50 mg/kg in day-old chicks[3]. | | IC 50 | Aromatase |
| | (R)-(+)-AMINOGLUTETHIMIDE 97 Preparation Products And Raw materials |
|