| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2 4-Dicyano-3-ethyl-3-methylglutarimide& Basic information |
| Product Name: | 2 4-Dicyano-3-ethyl-3-methylglutarimide& | | Synonyms: | 3,5-dicyano-4,4-methylethylglutarimide;4-ethyl-4-methyl-2,6-dioxo-3,5-piperidine dicarbonitrile;3-Ethyl-3-methyl-2,4-dicyanoglutarimide;4-ethyl-2,6-diketo-4-methyl-piperidine-3,5-dicarbonitrile;4-ethyl-4-methyl-2,6-dioxo-piperidine-3,5-dicarbonitrile;4-ethyl-4-methyl-2,6-dioxopiperidine-3,5-dicarbonitrile;2,4-dicyano-3-ethyl-3-methyl-glutarimid;2,6-dioxo-4-ethyl-4-methyl-5-piperidinedicarbonitrile | | CAS: | 1135-62-2 | | MF: | C10H11N3O2 | | MW: | 205.21 | | EINECS: | | | Product Categories: | Building Blocks;C10;Chemical Synthesis;Heterocyclic Building Blocks;Piperidines | | Mol File: | 1135-62-2.mol |  |
| | 2 4-Dicyano-3-ethyl-3-methylglutarimide& Chemical Properties |
| Melting point | 183-187 °C (lit.) | | Boiling point | 483.651±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.233±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 7.291±0.60(predicted) | | form | solid | | InChI | 1S/C10H11N3O2/c1-3-10(2)6(4-11)8(14)13-9(15)7(10)5-12/h6-7H,3H2,1-2H3,(H,13,14,15) | | InChIKey | ISARNQWKABTJEY-UHFFFAOYSA-N | | SMILES | CCC1(C)C(C#N)C(=O)NC(=O)C1C#N |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | RTECS | TM7066160 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral | | Toxicity | mouse,LD50,intraperitoneal,292mg/kg (292mg/kg),BEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLDLUNGS, THORAX, OR RESPIRATION: DYSPNEABEHAVIORAL: ATAXIA,Biomedica Biochimica Acta. Vol. 44, Pg. 795, 1985. |
| | 2 4-Dicyano-3-ethyl-3-methylglutarimide& Usage And Synthesis |
| | 2 4-Dicyano-3-ethyl-3-methylglutarimide& Preparation Products And Raw materials |
|