|
|
| | CHLORO[(1,2,3-Η)-3-PHENYL-2-PROPENYL][1,3-BIS(2,6-DI-I-PROPYLPHENYL)-4,5-DIHYDROIMIDAZOL-2-YLIDENE]PALLADIUM(II) Basic information | | Reaction |
| Product Name: | CHLORO[(1,2,3-Η)-3-PHENYL-2-PROPENYL][1,3-BIS(2,6-DI-I-PROPYLPHENYL)-4,5-DIHYDROIMIDAZOL-2-YLIDENE]PALLADIUM(II) | | Synonyms: | Palladium, [1,3-bis[2,6-bis(1-methylethyl)phenyl]-2-imidazolidinylidene]chloro[(1,2,3-η)-1-phenyl-2-propen-1-yl]-, stereoisomer;Chloro[(1,2,3-n)-3-phenyl-2-propenyl][1,3-bis(2,6-di-i-propylphenyl)-4,5-dihydroimidazol-2-ylidene]palladium(II), min. 97%;Chloro[(1,2,3-η)-3-phenyl-2-propenyl][1,3-bis(2,6-di-i-propylphenyl)-4,5-dihydroimidazol-2-ylidene]palladium (II), min. 97%;CHLORO[(1,2,3-Η)-3-PHENYL-2-PROPENYL][1,3-BIS(2,6-DI-I-PROPYLPHENYL)-4,5-DIHYDROIMIDAZOL-2-YLIDENE]PALLADIUM(II);Chloro[(1,2,3-n)-3-phenyl-2-propenyl][1,3-bis(2,6-di-i-propylphenyl)-4,5-dihydroimidazol-2-ylidene]palladium(II),min.97%;PHENYLALLYLCHLORO-[1,3-BIS(DIISOPROPYLPHENYL)-2-IMIDAZOLIDINYLIDENE]PALLADIUM(II);[1,3-Bis(2,6-di-isopropylphenyl)-4,5-dihydroimidazol-2-ylidene]chloro][3-phenylallyl]palladium(II) 95%;Chloro[(1,2,3-n)-3-phenyl-2-propenyl][1,3-bis(2,6-di-i-propylphenyl)-4, 5-dihydroimidazol-2-ylidene]palladium(II), min. 97% | | CAS: | 884879-24-7 | | MF: | C36H44ClN2Pd | | MW: | 646.63 | | EINECS: | | | Product Categories: | Pd;metal organo complex | | Mol File: | 884879-24-7.mol | ![CHLORO[(1,2,3-Η)-3-PHENYL-2-PROPENYL][1,3-BIS(2,6-DI-I-PROPYLPHENYL)-4,5-DIHYDROIMIDAZOL-2-YLIDENE]PALLADIUM(II) Structure](CAS/GIF/884879-24-7.gif) |
| | CHLORO[(1,2,3-Η)-3-PHENYL-2-PROPENYL][1,3-BIS(2,6-DI-I-PROPYLPHENYL)-4,5-DIHYDROIMIDAZOL-2-YLIDENE]PALLADIUM(II) Chemical Properties |
| Melting point | 0°C | | Boiling point | 0°C | | Fp | 0°C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | powder | | Appearance | Light yellow to yellow Solid | | InChIKey | KEHHNXMVROYFNY-UHFFFAOYSA-M | | SMILES | [CH2][CH][CH]c1ccccc1.CC(C)c2cccc(C(C)C)c2N3CCN(\C3=[Pd]/Cl)c4c(cccc4C(C)C)C(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | CHLORO[(1,2,3-Η)-3-PHENYL-2-PROPENYL][1,3-BIS(2,6-DI-I-PROPYLPHENYL)-4,5-DIHYDROIMIDAZOL-2-YLIDENE]PALLADIUM(II) Usage And Synthesis |
| Reaction | Catalyst used for the room temperature Buchwald-Hartwig amination of hindered aryl chlorides.
| | Chemical Properties | Light yellow crystal | | Uses | Catalyst for:
- Heterocyclization reactions
- Buchwald-Hartwig cross coupling
- Suzuki-Miyaura reactions
| | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
| | CHLORO[(1,2,3-Η)-3-PHENYL-2-PROPENYL][1,3-BIS(2,6-DI-I-PROPYLPHENYL)-4,5-DIHYDROIMIDAZOL-2-YLIDENE]PALLADIUM(II) Preparation Products And Raw materials |
|