|
|
| | T-2-(3-(4-T-BU.-PHENYL)-2-ME-2-PROPENYL& Basic information |
| Product Name: | T-2-(3-(4-T-BU.-PHENYL)-2-ME-2-PROPENYL& | | Synonyms: | trans-2-[3-(4-tert-Butylphenyl)-2-methyl-2-propenylidene]malononitrile;trans-2-[3-(4-tert-Butylphenyl)-2-Methyl-2-propenylidene]Malononitrile >=98%;T-2-(3-(4-T-BU.-PHENYL)-2-ME-2-PROPENYL&;T-2-(3-(4-T-BU.-PHENYL)-2-ME-2-PROPENYLIDENE)MALONONITRILE;2-[(E)-3-(4-tert-butylphenyl)-2-methylprop-2-enylidene]propanedinitrile;trans-2-[3-(4-tert-Butylphenyl)-2-methyl-2-propenylidene]malononitrile >;Propanedinitrile, 2-[(2E)-3-[4-(1,1-dimethylethyl)phenyl]-2-methyl-2-propen-1-ylidene]-;(E)-2-(3-(4-(tert-butyl)phenyl)-2-methylallylidene)malononitrile | | CAS: | 300364-84-5 | | MF: | C17H18N2 | | MW: | 250.34 | | EINECS: | | | Product Categories: | | | Mol File: | 300364-84-5.mol |  |
| | T-2-(3-(4-T-BU.-PHENYL)-2-ME-2-PROPENYL& Chemical Properties |
| Melting point | 123-126 °C | | Boiling point | 392.5±37.0 °C(Predicted) | | density | 1.029±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | powder to crystal | | color | Light orange to Yellow to Green | | BRN | 8913051 | | Stability: | Light Sensitive | | InChI | 1S/C17H18N2/c1-13(10-15(11-18)12-19)9-14-5-7-16(8-6-14)17(2,3)4/h5-10H,1-4H3/b13-9+ | | InChIKey | OIASAVWSBWJWBR-UKTHLTGXSA-N | | SMILES | CC(=C/c1ccc(cc1)C(C)(C)C)\C=C(\C#N)C#N | | Absorption | >2000 at 337nm (mol. absorption) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | RIDADR | 3439 | | WGK Germany | 3 | | F | 9 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | T-2-(3-(4-T-BU.-PHENYL)-2-ME-2-PROPENYL& Usage And Synthesis |
| Uses | trans-2-[3-(4-tert-Butylphenyl)-2-methyl-2-propenylidene]malononitrile is a useful compound with applications in drug delivery. | | Definition | ChEBI: Trans-2-[3-(4-tert-butylphenyl)-2-methyl-2-propenylidene]malononitrile is a dinitrile that is tert-butylbenzene in which the hydrogen at the para- position is substituted by a 4,4-dicyano-2-methylbuta-1,3-dien-1-yl group (the trans isomer). It is used as a matrix in matrix-assisted laser desorption/ionization (MALDI) mass spectrometry. It has a role as a MALDI matrix material. |
| | T-2-(3-(4-T-BU.-PHENYL)-2-ME-2-PROPENYL& Preparation Products And Raw materials |
|