| Company Name: |
GIHI CHEMICALS CO.,LIMITED |
| Tel: |
+86-571-86217390; +8618058761490 |
| Email: |
info@gihichemicals.com |
| Products Intro: |
Product Name:Isoquinoline,1,2,3,4,5,6,7,8-octahydro-1-[(4-methoxyphenyl)methyl]-, (1R)-
CAS:30356-08-2
Purity:99 Package:5KG;1KG,25kg
|
|
|
|
|
|
| | (R)-1-(4-METHOXYBENZYL)-1 2 3 4 5 6 7 8& Basic information |
| Product Name: | (R)-1-(4-METHOXYBENZYL)-1 2 3 4 5 6 7 8& | | Synonyms: | (1R)-1-[(4-methoxyphenyl)methyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline;(R)-1,2,3,4,5,6,7,8-Octahydro-1-[(4-methoxyphenyl)methyl]isochinolin;(R)-1-(4-METHOXYBENZYL)-1 2 3 4 5 6 7 8&;(R)-1,2,3,4,5,6,7,8-octahydro-1-[(4-methoxyphenyl)methyl]isoquinoline;OCTABASE;Einecs 250-145-0;Isoquinoline, 1,2,3,4,5,6,7,8-octahydro-1-[(4-methoxyphenyl)methyl]-, (1R)-;Dextromethorphan Impurity 13 | | CAS: | 30356-08-2 | | MF: | C17H23NO | | MW: | 257.37 | | EINECS: | 250-145-0 | | Product Categories: | CMLLYL | | Mol File: | 30356-08-2.mol |  |
| | (R)-1-(4-METHOXYBENZYL)-1 2 3 4 5 6 7 8& Chemical Properties |
| Boiling point | 394.8±27.0 °C(Predicted) | | density | 1.108 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.565(lit.) | | Fp | >230 °F | | solubility | Chloroform (Slightly, Sonicated), Methanol (Slightly) | | pka | 10.20±0.40(Predicted) | | form | Oil | | color | Light Yellow to Yellow | | InChI | InChI=1S/C17H23NO/c1-19-15-8-6-13(7-9-15)12-17-16-5-3-2-4-14(16)10-11-18-17/h6-9,17-18H,2-5,10-12H2,1H3/t17-/m1/s1 | | InChIKey | NPEVCJZMQGZNET-QGZVFWFLSA-N | | SMILES | [C@@H]1(CC2=CC=C(OC)C=C2)C2=C(CCCC2)CCN1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| | (R)-1-(4-METHOXYBENZYL)-1 2 3 4 5 6 7 8& Usage And Synthesis |
| Uses | (R)-1,2,3,4,5,6,7,8-Octahydro-1-[(4-methoxyphenyl)methyl]isoquinoline is an intermediate in the synthesis of N-Formyl Octabase (F700890), which is used in the synthertic preparation of morphinans and isoquinoline alkaloids. |
| | (R)-1-(4-METHOXYBENZYL)-1 2 3 4 5 6 7 8& Preparation Products And Raw materials |
|