| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:5-(3,4-dichlorophenyl)-2-furaldehyde(SALTDATA: FREE) CAS:52130-34-4 Purity:95% Package:1G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:5-(3,4-Dichlorophenyl)furfural CAS:52130-34-4 Purity:97% Package:5G
|
|
| | 5-(3,4-Dichlorophenyl)furfural Basic information |
| | 5-(3,4-Dichlorophenyl)furfural Chemical Properties |
| Melting point | 140-143 °C (lit.) | | form | solid | | InChI | 1S/C11H6Cl2O2/c12-9-3-1-7(5-10(9)13)11-4-2-8(6-14)15-11/h1-6H | | InChIKey | PSQLTDROSWBPGT-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(o1)-c2ccc(Cl)c(Cl)c2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-(3,4-Dichlorophenyl)furfural Usage And Synthesis |
| | 5-(3,4-Dichlorophenyl)furfural Preparation Products And Raw materials |
|