5,7-Dihydroxy-4-phenylcoumarin manufacturers
- LC3-mHTT-IN-AN2
-
- $57.00
-
2026-07-20
- CAS:7758-73-8
- Purity: 98.05%
- Supply Ability: 10g
|
| | 5,7-Dihydroxy-4-phenylcoumarin Basic information |
| Product Name: | 5,7-Dihydroxy-4-phenylcoumarin | | Synonyms: | 5,7-Dihydroxy-4-phenyl-2H-1-benzopyran-2-one;5,7-Dihydroxy-4-phenyl-2H-chromen-2-one;5,7-dihydroxy-4-phenyl-2-chromenone;5,7-Dihydroxy-4-phenyl-chromen-2-one;5,7-dihydroxy-4-phenylchromen-2-one;2H-1-Benzopyran-2-one, 5,7-dihydroxy-4-phenyl-;5,7-dihydroxy-4-phenyl-1-benzopyran-2-one;inhibit,Autophagy,Autophagosome-tethering compounds,LC3mHTTINAN2,ATTECs,Inhibitor,LC-3-mHTT-IN-AN2,LC3 mHTT IN AN2 | | CAS: | 7758-73-8 | | MF: | C15H10O4 | | MW: | 254.24 | | EINECS: | | | Product Categories: | Building Blocks;Coumarins;Heterocyclic Building Blocks;Coumarin;Building Blocks;Chemical Synthesis;Heterocyclic Building Blocks | | Mol File: | 7758-73-8.mol |  |
| | 5,7-Dihydroxy-4-phenylcoumarin Chemical Properties |
| Melting point | 227-233 °C (lit.) | | Boiling point | 535.5±19.0 °C(Predicted) | | density | 1.443 | | storage temp. | Store at -20°C | | solubility | DMSO: 250 mg/mL (983.32 mM) | | pka | 7.09±0.20(Predicted) | | form | Solid | | color | Light yellow to yellow | | InChI | InChI=1S/C15H10O4/c16-10-6-12(17)15-11(9-4-2-1-3-5-9)8-14(18)19-13(15)7-10/h1-8,16-17H | | InChIKey | HUQKUJNSVHEHIH-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=CC(O)=CC(O)=C2C(C2=CC=CC=C2)=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5,7-Dihydroxy-4-phenylcoumarin Usage And Synthesis |
| Uses | LC3-mHTT-IN-AN2 (Compound AN2) is a mHTT-LC3 linker compound, which interacts with both mutant huntingtin protein (mHTT) and LC3B but not with wtHTT or irrelevant control proteins. LC3-mHTT-IN-AN2 reduces the levels of mHTT in an allele-selective manner in cultured Huntington disease (HD) mouse neurons[1]. | | References | [1] Li Z, et al. Allele-selective lowering of mutant HTT protein by HTT-LC3 linker compounds. Nature. 2019 Oct 30. DOI:10.1038/s41586-019-1722-1 |
| | 5,7-Dihydroxy-4-phenylcoumarin Preparation Products And Raw materials |
|