|
|
| | 4 4'-BIS(TRIETHOXYSILYL)-1 1'-BIPHENYL Basic information |
| Product Name: | 4 4'-BIS(TRIETHOXYSILYL)-1 1'-BIPHENYL | | Synonyms: | 4 4'-BIS(TRIETHOXYSILYL)-1 1'-BIPHENYL;4,4′-Bis(triethoxysilyl)-1,1′-biphenyl,4,4′-Bis(triethoxysilyl)biphenyl;4,4'-Biphenyldiylbis(triethoxysilane);1,1'-Biphenyl,4,4'-bis(triethoxysilyl)-;triethoxy-[4-(4-triethoxysilylphenyl)phenyl]silane;4,4'-Bis(triethoxysilyl)-1,1'-biphenyl 95%;TIANFU CHEM- 4 4'-BIS(TRIETHOXYSILYL)-1 1'-BIPHENYL;4,4'-bis(triethoxysilyl)-1,1'-biphenyl | | CAS: | 123640-93-7 | | MF: | C24H38O6Si2 | | MW: | 478.73 | | EINECS: | | | Product Categories: | | | Mol File: | 123640-93-7.mol |  |
| | 4 4'-BIS(TRIETHOXYSILYL)-1 1'-BIPHENYL Chemical Properties |
| Boiling point | 203-206 °C0.3 mm Hg(lit.) | | density | 1.047 g/mL at 25 °C(lit.) | | refractive index | 1.5039 | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | Specific Gravity | 1.047 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C24H38O6Si2/c1-7-25-31(26-8-2,27-9-3)23-17-13-21(14-18-23)22-15-19-24(20-16-22)32(28-10-4,29-11-5)30-12-6/h13-20H,7-12H2,1-6H3 | | InChIKey | KENDGHJJHKCUNB-UHFFFAOYSA-N | | SMILES | CCO[Si](OCC)(OCC)c1ccc(cc1)-c2ccc(cc2)[Si](OCC)(OCC)OCC |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 4 |
| | 4 4'-BIS(TRIETHOXYSILYL)-1 1'-BIPHENYL Usage And Synthesis |
| Uses | suzuki reaction | | Uses | 4,4′-Bis(triethoxysilyl)-1,1′-biphenyl (BTESB) can be used as an indicator to determine the chirality of helical silica nanotubes.
BTESB can also be utilized as a precursor to prepare:
- Helical 4, 4′-biphenylene-silica nanotubes and nanoribbons using 3-aminopropyltrimethoxysilane as a co-structure-directing agent.
- Biphenyl-bridged alkoxysilane-based crosslinked polyalkoxysilane by condensation with linear aliphatic diols.
- Biphenylene-bridged silsesquioxane thin films by the sol-gel method.
|
| | 4 4'-BIS(TRIETHOXYSILYL)-1 1'-BIPHENYL Preparation Products And Raw materials |
|