|
|
| | (S)-((2-Guanidino-4-thiazolyl)methylisothiourea dihydrochloride Basic information |
| | (S)-((2-Guanidino-4-thiazolyl)methylisothiourea dihydrochloride Chemical Properties |
| Melting point | >188oC (dec.) | | storage temp. | Refrigerator | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | PH | 3.89 at 1000g/L | | InChI | InChI=1S/C6H10N6S2.ClH/c7-4(8)12-6-11-3(2-14-6)1-13-5(9)10;/h2H,1H2,(H3,9,10)(H4,7,8,11,12);1H | | InChIKey | DMXJVYCDETXZRR-UHFFFAOYSA-N | | SMILES | N(C1SC=C(CSC(N)=N)N=1)C(N)=N.Cl | | LogP | 1 at 30℃ and pH3.89 |
| | (S)-((2-Guanidino-4-thiazolyl)methylisothiourea dihydrochloride Usage And Synthesis |
| Chemical Properties | Beige crystals, melting point 215-216°C (189-191.5°C). | | Uses | Famotidine intermediate. | | Definition |
Famotidine EP Impurity H is chemically (S)-((2-Guanidino-4-thiazolyl)methylisothiourea dihydrochloride. It is also known as Famotidine Isothiourea Impurity . Famotidine EP Impurity H can be used for the analytical method development, method validation (AMV), Quality Controlled (QC) application for Abbreviated New Drug Application (ANDA) or during commercial production of Famotidine.
|
| | (S)-((2-Guanidino-4-thiazolyl)methylisothiourea dihydrochloride Preparation Products And Raw materials |
|