Boronic acid, B-[3-bromo-5-(1,1-dimethylethyl)phenyl]- manufacturers
|
| | Boronic acid, B-[3-bromo-5-(1,1-dimethylethyl)phenyl]- Basic information |
| | Boronic acid, B-[3-bromo-5-(1,1-dimethylethyl)phenyl]- Chemical Properties |
| Melting point | 220-230° | | Boiling point | 342.9±52.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 7.66±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C10H14BBrO2/c1-10(2,3)7-4-8(11(13)14)6-9(12)5-7/h4-6,13-14H,1-3H3 | | InChIKey | IYYXDZHRVBGUAG-UHFFFAOYSA-N | | SMILES | B(C1=CC(C(C)(C)C)=CC(Br)=C1)(O)O |
| | Boronic acid, B-[3-bromo-5-(1,1-dimethylethyl)phenyl]- Usage And Synthesis |
| | Boronic acid, B-[3-bromo-5-(1,1-dimethylethyl)phenyl]- Preparation Products And Raw materials |
|