|
|
| | 2-Propenamide, 2-cyano-3-(3,4,5-trihydroxyphenyl)- Basic information |
| | 2-Propenamide, 2-cyano-3-(3,4,5-trihydroxyphenyl)- Chemical Properties |
| Boiling point | 629.5±55.0 °C(Predicted) | | density | 1.616±0.06 g/cm3(Predicted) | | pka | 8.39±0.15(Predicted) | | InChI | InChI=1S/C10H8N2O4/c11-4-6(10(12)16)1-5-2-7(13)9(15)8(14)3-5/h1-3,13-15H,(H2,12,16) | | InChIKey | IZDSLPGXLRWXIF-UHFFFAOYSA-N | | SMILES | C(N)(=O)C(C#N)=CC1=CC(O)=C(O)C(O)=C1 |
| | 2-Propenamide, 2-cyano-3-(3,4,5-trihydroxyphenyl)- Usage And Synthesis |
| Uses | (E)-2-Cyano-3-(3,4,5-trihydroxyphenyl)prop-2-enamide is a useful research chemical used in the preparation of inhibitors of protein-tyrosine kinase p56lck. |
| | 2-Propenamide, 2-cyano-3-(3,4,5-trihydroxyphenyl)- Preparation Products And Raw materials |
|