| Company Name: |
Guangzhou Younan Technology Co., Ltd Gold
|
| Tel: |
020-82000279 18988941452 |
| Email: |
YN_research@163.com |
| Products Intro: |
Product Name:N-NITROSOANATABINE CAS:887407-16-1 Purity:95%+ Package:250mg/RMB 4580;500mg1mg
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:(R,S)-N-Nitrosoanatabine, 98% CAS:887407-16-1 Purity:98% Package:25MG;5MG
|
| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:N-NITROSOANATABINE CAS:887407-16-1 Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
|
| | N-NITROSOANATABINE Basic information |
| Product Name: | N-NITROSOANATABINE | | Synonyms: | N-NITROSOANATABINE;(R,S)-NAT;1,2,3,6-Tetrahydro-1-nitroso-2,3'-bipyridine;2,3'-Bipyridine, 1,2,3,6-tetrahydro-1-nitroso-;1-nitroso-1,2,3,6-tetrahydro-2,3'-bipyridine;N-Nitroso-neonicotine;(R,S)-N-Nitroso Atabine;(±)-N-Nitrosoanatabine in acetonitrile | | CAS: | 887407-16-1 | | MF: | C10H11N3O | | MW: | 189.21 | | EINECS: | | | Product Categories: | Nitro CompoundsAlphabetic;NJ - NZAnalytical Standards;Analytical Standards;Chemical Class;Chromatography;N;Standards for SupelMIPTM SPE;Heterocycles;Mutagenesis Research Chemicals;Nicotine Derivatives | | Mol File: | 887407-16-1.mol |  |
| | N-NITROSOANATABINE Chemical Properties |
| Boiling point | 367.8±42.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | Chloroform: slightly soluble; Ethyl Acetate: slightly soluble | | pka | 5.06±0.12(Predicted) | | Stability: | Light Sensitive | | InChI | InChI=1S/C10H11N3O/c14-12-13-7-2-1-5-10(13)9-4-3-6-11-8-9/h1-4,6,8,10H,5,7H2 | | InChIKey | ZJOFAFWTOKDIFH-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CN=C2)N(N=O)CC=CC1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN2810 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 29399990 |
| | N-NITROSOANATABINE Usage And Synthesis |
| Chemical Properties | Clear Yellow Oil | | Uses | (R,S)-N-Nitroso Anatabine is a metabolite of tobacco, a specific N-nitrosamines. (R,S)-N-Nitroso Anatabine | | Uses | A metabolite of tobacco, a specific N-nitrosamines. Shows mutagenic effects |
| | N-NITROSOANATABINE Preparation Products And Raw materials |
|