| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | Chitobiose Dihydrochloride Basic information |
| Product Name: | Chitobiose Dihydrochloride | | Synonyms: | Chitobiose hydrochlorid;D-Glucose,2-amino-4-O-(2-amino-2-deoxy-β-D-glucopyranosyl)-2-deoxy-,dihydrochloride;Chitobiose hydrochloride(Mixture of alpha and beta Isomers);Shell dextrin dihydrochloride | | CAS: | 115350-24-8 | | MF: | C12H25ClN2O9 | | MW: | 376.79 | | EINECS: | | | Product Categories: | | | Mol File: | 115350-24-8.mol |  |
| | Chitobiose Dihydrochloride Chemical Properties |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Pale Yellow | | Stability: | Hygroscopic | | InChI | InChI=1/C12H24N2O9.ClH/c13-4(1-15)8(19)11(5(18)2-16)23-12-7(14)10(21)9(20)6(3-17)22-12;/h1,4-12,16-21H,2-3,13-14H2;1H/t4-,5+,6+,7+,8+,9+,10+,11+,12-;/s3 | | InChIKey | DBLNNBSBPLLJBK-APUMTOCPNA-N | | SMILES | O([C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)N)[C@]([H])([C@H](O)CO)[C@H](O)[C@@H](N)C=O.Cl |&1:1,2,3,5,7,12,14,18,20,r| |
| | Chitobiose Dihydrochloride Usage And Synthesis |
| Uses | Chitobiose dihydrochloride, a chitosan oligosaccharide, is a dimer of β-1,4-linked glucosamine units[1]. | | References | [1] Qini Zhao, et al. Chitoheptaose Promotes Heart Rehabilitation in a Rat Myocarditis Model by Improving Antioxidant, Anti-Inflammatory, and Antiapoptotic Properties. Oxid Med Cell Longev. 2020 Apr 11;2020:2394704. DOI:10.1155/2020/2394704 |
| | Chitobiose Dihydrochloride Preparation Products And Raw materials |
|