| Company Name: |
Shandong Boluoda Biological Technology Co., Ltd.
|
| Tel: |
0531-68652053 15863796298; |
| Email: |
2310993908@qq.com |
| Products Intro: |
Product Name:Dapagliflozin Impurity II
CAS:2069934-29-6
Purity:95% HPLC Package:10mg；25mg；50mg；100mg；200mg；500mg；1g
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Dapagliflozin Impurity 48
CAS:2069934-29-6
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
Dapagliflozin Impurity 48 manufacturers
|
| | Dapagliflozin Impurity 48 Basic information |
| Product Name: | Dapagliflozin Impurity 48 | | Synonyms: | Dapagliflozin Impurity 48;Benzene, 1,4-dichloro-2-[(4-ethoxyphenyl)methyl]-;1,4-dichloro-2-(4-ethoxybenzyl)benzeneQ: What is
1,4-dichloro-2-(4-ethoxybenzyl)benzene Q: What is the CAS Number of
1,4-dichloro-2-(4-ethoxybenzyl)benzene;Dapagliflozin Impurity II;1,4-dichloro-2-[(4-ethoxyphenyl)methyl]-benzene | | CAS: | 2069934-29-6 | | MF: | C15H14Cl2O | | MW: | 281.18 | | EINECS: | | | Product Categories: | | | Mol File: | 2069934-29-6.mol |  |
| | Dapagliflozin Impurity 48 Chemical Properties |
| InChI | InChI=1S/C15H14Cl2O/c1-2-18-14-6-3-11(4-7-14)9-12-10-13(16)5-8-15(12)17/h3-8,10H,2,9H2,1H3 | | InChIKey | NJURDXZWUGNUHB-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(Cl)C=C1CC1=CC=C(OCC)C=C1 |
| | Dapagliflozin Impurity 48 Usage And Synthesis |
| | Dapagliflozin Impurity 48 Preparation Products And Raw materials |
|