| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 3-Azabicyclo[3.3.1]nonan-9-one, 3-(1-methylethyl)- Basic information |
| | 3-Azabicyclo[3.3.1]nonan-9-one, 3-(1-methylethyl)- Chemical Properties |
| form | solid | | InChI | 1S/C11H19NO/c1-8(2)12-6-9-4-3-5-10(7-12)11(9)13/h8-10H,3-7H2,1-2H3/t9-,10+ | | InChIKey | XJMQPSKRAIRWLP-AOOOYVTPSA-N | | SMILES | O=C1[C@@]2([H])CN(C(C)C)C[C@@]([H])1CCC2 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-Azabicyclo[3.3.1]nonan-9-one, 3-(1-methylethyl)- Usage And Synthesis |
| | 3-Azabicyclo[3.3.1]nonan-9-one, 3-(1-methylethyl)- Preparation Products And Raw materials |
|