| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
|
| | 1-[4-(1-Hydroxy-2-methylpropyl)phenyl]ethanone Basic information |
| | 1-[4-(1-Hydroxy-2-methylpropyl)phenyl]ethanone Chemical Properties |
| Boiling point | 323.7±17.0 °C(Predicted) | | density | 1.036±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform; Dichloromethane; Ethyl Acetate; Methanol; Acetone | | pka | 13.87±0.20(Predicted) | | form | Oil | | color | Pale brown | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C12H16O2/c1-8(2)12(14)11-6-4-10(5-7-11)9(3)13/h4-8,12,14H,1-3H3 | | InChIKey | YOUODLUMPRHZCA-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(C(O)C(C)C)C=C1)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | 1-[4-(1-Hydroxy-2-methylpropyl)phenyl]ethanone Usage And Synthesis |
| Uses | 1-[4-(1-Hydroxy-2-methylpropyl)phenyl]ethanone is an intermediate in the synthesis of 1-(4-(1-Hydroperoxy-2-methyl)propyl)phenyl)ethan-1-one (H354985). It is useful in the research studies of ibuprofen. |
| | 1-[4-(1-Hydroxy-2-methylpropyl)phenyl]ethanone Preparation Products And Raw materials |
|