| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4,4,4-Trifluoro-1-(5-fluoro-2-methoxyphenyl)butane-1,3-dione Basic information |
| Product Name: | 4,4,4-Trifluoro-1-(5-fluoro-2-methoxyphenyl)butane-1,3-dione | | Synonyms: | 4,4,4-Trifluoro-1-(5-fluoro-2-methoxyphenyl)butane-1,3-dione;1,3-Butanedione, 4,4,4-trifluoro-1-(5-fluoro-2-methoxyphenyl)-;4,4,4-Trifluoro-1-(5-fluoro-2-methoxyphenyl)-1,3-butanedione | | CAS: | 1202030-54-3 | | MF: | C11H8F4O3 | | MW: | 264.17 | | EINECS: | | | Product Categories: | | | Mol File: | 1202030-54-3.mol |  |
| | 4,4,4-Trifluoro-1-(5-fluoro-2-methoxyphenyl)butane-1,3-dione Chemical Properties |
| Boiling point | 301.1±37.0 °C(Predicted) | | density | 1.349±0.06 g/cm3(Predicted) | | pka | 5.44±0.23(Predicted) | | form | solid | | InChI | 1S/C11H8F4O3/c1-18-9-3-2-6(12)4-7(9)8(16)5-10(17)11(13,14)15/h2-4H,5H2,1H3 | | InChIKey | LRTGIUPYSQAVER-UHFFFAOYSA-N | | SMILES | COC1=C(C(CC(C(F)(F)F)=O)=O)C=C(F)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | 4,4,4-Trifluoro-1-(5-fluoro-2-methoxyphenyl)butane-1,3-dione Usage And Synthesis |
| | 4,4,4-Trifluoro-1-(5-fluoro-2-methoxyphenyl)butane-1,3-dione Preparation Products And Raw materials |
|