- 2-Cyano-5-methylpyridine
-
- $5.00 / 1KG
-
2025-09-25
- CAS:1620-77-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Cyano-5-methylpyridine Basic information |
| | 2-Cyano-5-methylpyridine Chemical Properties |
| Melting point | 73-75°C | | Boiling point | 140°C/20mmHg(lit.) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | pka | -0.03±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C7H6N2/c1-6-2-3-7(4-8)9-5-6/h2-3,5H,1H3 | | InChIKey | LIEQVZZZYLHNRH-UHFFFAOYSA-N | | SMILES | C1(C#N)=NC=C(C)C=C1 | | CAS DataBase Reference | 1620-77-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3439 | | HazardClass | IRRITANT | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2933399990 |
| | 2-Cyano-5-methylpyridine Usage And Synthesis |
| Chemical Properties | Light yellow Cryst | | Uses | 2-Cyano-5-methylpyridine (5-methylpicolinonitrile) is a methylpyridine analogue mainly used as a raw material or intermediate component in organic synthesis. It is used in the synthesis of 5-Methylpicolinaldehyde and its derivatives. |
| | 2-Cyano-5-methylpyridine Preparation Products And Raw materials |
|