2'-Deoxyguanosine-5'-diphosphate trisodium salt manufacturers
|
| | 2'-Deoxyguanosine-5'-diphosphate trisodium salt Basic information |
| Product Name: | 2'-Deoxyguanosine-5'-diphosphate trisodium salt | | Synonyms: | 2'-DEOXYGUANOSINE-5'-DIPHOSPHATE DISODIUM SALT;2'-DEOXYGUANOSINE 5'-DIPHOSPHATE SODIUM SALT;2''-DEOXYGUANOSINE-5''-DIPHOSPHATE, DISODIUM SALT (DGDP.NA2);2''-DEOXYGUANOSINE-5''-DIPHOSPHATE TRISODIUM SALT;2'-Deoxyguanosine 5'-diphosphoric acid;(2S)-2β,5β-Bis(hydroxymethyl)pyrrolidine-3β,4α-diol;2,5-Imino-2,5-dideoxy-D-glucitol;[5-(2-amino-6-keto-3H-purin-9-yl)-3-hydroxy-tetrahydrofuran-2-yl]methyl phosphono hydrogen phosphate | | CAS: | 102783-74-4 | | MF: | C10H12N5Na3O10P2 | | MW: | 493.15 | | EINECS: | 634-395-1 | | Product Categories: | Pharmaceutical | | Mol File: | 102783-74-4.mol |  |
| | 2'-Deoxyguanosine-5'-diphosphate trisodium salt Chemical Properties |
| Melting point | >178°C (dec.) | | storage temp. | -20°C | | solubility | Aqueous Base (Slightly), Water (Slightly) | | form | Powder | | color | White | | Water Solubility | Soluble in water. | | Stability: | Hygroscopic | | InChI | 1S/C10H15N5O10P2.Na.H/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(24-6)2-23-27(21,22)25-26(18,19)20;;/h3-6,16H,1-2H2,(H,21,22)(H2,18,19,20)(H3,11,13,14,17);; | | InChIKey | VLWIICGGBFZYEZ-UHFFFAOYSA-N | | SMILES | [Na].NC1=NC(=O)c2ncn(C3CC(O)C(COP(O)(=O)OP(O)(O)=O)O3)c2N1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2'-Deoxyguanosine-5'-diphosphate trisodium salt Usage And Synthesis |
| Uses | 2′-Deoxyguanosine 5′-diphosphate (dGDP) is used as a substrate of dGDP (nucleoside diphosphate) kinase (2.7.4.6) or pyruvate kinase to produce dGTP in support of DNA biosynthesis. dGDP is used as a substrate to study the kinetics of glycoprotein (gp) 1.7 expressed by bacteriophage T7. | | General Description | 2′-Deoxyguanosine 5′-diphosphate (dGDP) is a nucleotide with guanine base, deoxyribose and two phosphate. | | Biochem/physiol Actions | 2′-Deoxyguanosine 5′-diphosphate (dGDP) inhibits xanthine phosphoribosyl transferase (XPRT) and hypoxanthine-guanine phosphoribosyl transferase (HGPRT). |
| | 2'-Deoxyguanosine-5'-diphosphate trisodium salt Preparation Products And Raw materials |
|