|
|
| | 5-(4-CHLOROPHENYL)-2-FUROIC ACID Basic information |
| | 5-(4-CHLOROPHENYL)-2-FUROIC ACID Chemical Properties |
| Melting point | 198-201 °C (dec.)(lit.) | | Boiling point | 394.4±32.0 °C(Predicted) | | density | 1.374±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | Powder | | pka | 3.00±0.10(Predicted) | | color | Pale brown | | InChI | 1S/C11H7ClO3/c12-8-3-1-7(2-4-8)9-5-6-10(15-9)11(13)14/h1-6H,(H,13,14) | | InChIKey | XIPQHWUSDHTXOO-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(o1)-c2ccc(Cl)cc2 | | CAS DataBase Reference | 41019-45-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29321900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-(4-CHLOROPHENYL)-2-FUROIC ACID Usage And Synthesis |
| Chemical Properties | Pale brown powder | | Uses | 5-(4-Chlorophenyl)-2-furoic acid (5-(4-chlorophenyl)-2-furancarboxylic acid) is a 5-aryl-2-furancarboxylic acid. It has been synthesized by oxidation of the corresponding furaldehyde with silver nitrate and sodium hydroxide. It serves as an intermediate for the synthesis of 5-(5-aryl-2-furyl)-tetrazol-1-ylacetic acids, which are employed in the synthesis of semisynthetic cephalosporines. | | Definition | ChEBI: 5-(4-Chlorophenyl)-2-furoic acid is a furoic acid. | | General Description | 5-(4-Chlorophenyl)-2-furoic acid (5-(4-chlorophenyl)-2-furancarboxylic acid) is a 5-aryl-2-furancarboxylic acid. It has been synthesized by oxidation of the corresponding furaldehyde with silver nitrate and sodium hydroxide. It serves as an intermediate for the synthesis of 5-(5-aryl-2-furyl)-tetrazol-1-ylacetic acids, which are employed in the synthesis of semisynthetic cephalosporines. |
| | 5-(4-CHLOROPHENYL)-2-FUROIC ACID Preparation Products And Raw materials |
|