|
|
| | 2,2,3,3,3-Pentafluoropropyl acrylate Basic information |
| Product Name: | 2,2,3,3,3-Pentafluoropropyl acrylate | | Synonyms: | 1H,1H-PENTAFLUOROPROPYL ACRYLATE;2,2,3,3,3-PENTAFLUOROPROPYL ACRYLATE;PENTAFLUOROPROPYL ACRYLATE;2-Propenoic acid, 2,2,3,3,3-pentafluoropropyl ester;2,2,3,3,3-Pentafluoropropyl Acrylate (stabilized with TBC);JACS-356-86-5;2-propenoicacid,2,2,3,3,3-pentafluoropropylester;1H,1H-Pentafluoro-n-propyl acrylate | | CAS: | 356-86-5 | | MF: | C6H5F5O2 | | MW: | 204.09 | | EINECS: | 206-608-4 | | Product Categories: | Organic Building Blocks;Photonic and Optical Materials;Polymer Science;Self Assembly &;Waveguide Materials;monomer;Acrylic Monomers;C6 to C7Monomers;Carbonyl Compounds;Esters;Fluorinated AcrylicsSelf Assembly&Contact Printing;Fluorine-Containing Monomers for 157 nm UV Lithography Resist PolymersPhotonic and Optical Materials;Lithography Monomers;Low Refractive Index Monomers;Waveguide Materials;Acrylic Monomers;Building Blocks;C6 to C7;Carbonyl Compounds;Chemical Synthesis;Contact Printing;Fluorinated Acrylics;Fluorine-Containing Monomers for 157 nm UV Lithography Resist Polymers;Lithography Monomers;Low Refractive Index Monomers;Materials Science;Micro/NanoElectronics;Monomers;Organic and Printed Electronics | | Mol File: | 356-86-5.mol |  |
| | 2,2,3,3,3-Pentafluoropropyl acrylate Chemical Properties |
| Melting point | 49-50°C | | Boiling point | 50 °C/100 mmHg (lit.) | | density | 1.32 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.336(lit.) | | Fp | 73 °F | | storage temp. | 2-8°C | | form | liquid | | color | Clear, colourless | | Specific Gravity | 1.320 | | BRN | 1779140 | | InChI | InChI=1S/C6H5F5O2/c1-2-4(12)13-3-5(7,8)6(9,10)11/h2H,1,3H2 | | InChIKey | JDVGNKIUXZQTFD-UHFFFAOYSA-N | | SMILES | C(OCC(F)(F)C(F)(F)F)(=O)C=C | | CAS DataBase Reference | 356-86-5(CAS DataBase Reference) | | EPA Substance Registry System | 2,2,3,3,3-Pentafluoropropyl acrylate (356-86-5) |
| Hazard Codes | Xn,F | | Risk Statements | 10-20/21/22-36/37 | | Safety Statements | 16-26-36 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Flammable/Keep Cold | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29161290 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 3
STOT SE 3 |
| | 2,2,3,3,3-Pentafluoropropyl acrylate Usage And Synthesis |
| | 2,2,3,3,3-Pentafluoropropyl acrylate Preparation Products And Raw materials |
|