|
|
| | 4-Fluoro-3-iodo-1H-indazole Basic information |
| Product Name: | 4-Fluoro-3-iodo-1H-indazole | | Synonyms: | 4-FLUORO-3-IODO (1H)INDAZOLE;4-FLUORO-3-IODOINDAZOLE;1H-Indazole, 4-fluoro-3-iodo-;4-FLUORO-3-IODO-2H-INDAZOLE;4-Fluoro-3-iodo-1H-indazole 97% | | CAS: | 518990-32-4 | | MF: | C7H4FIN2 | | MW: | 262.02 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 518990-32-4.mol |  |
| | 4-Fluoro-3-iodo-1H-indazole Chemical Properties |
| Boiling point | 361.4±22.0 °C(Predicted) | | density | 2.158±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 11.26±0.40(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C7H4FIN2/c8-4-2-1-3-5-6(4)7(9)11-10-5/h1-3H,(H,10,11) | | InChIKey | PYFIFZHAAHFPEC-UHFFFAOYSA-N | | SMILES | N1C2=C(C(F)=CC=C2)C(I)=N1 |
| | 4-Fluoro-3-iodo-1H-indazole Usage And Synthesis |
| Uses | 4-Fluoro-3-iodo-1h-indazole | | Synthesis | Step 1: Preparation of 4-fluoro-3-iodo-1H-indazole (B-2). Iodine (I2) (18.64 g, 73.46 mmol) and potassium hydroxide (KOH) (7.73 g, 137.7 mmol) were sequentially added to a stirring solution of 4-fluoro-1H-indazole (B-i) (5.00 g, 36.73 mmol) in DMF (80 mL) at room temperature. After 2 hours of reaction, thin layer chromatography (TLC) monitoring showed completion of the reaction. The reaction mixture was slowly poured into 10% aqueous sodium bisulfite (NaHSO3) (200 mL) and extracted with ethyl acetate (EA) (3 x 200 mL). The organic layers were combined, washed sequentially with water (100 mL) and saturated saline (2×200 mL), dried over anhydrous sodium sulfate (Na2SO4), filtered and concentrated. The crude product was washed with petroleum ether (PE) to give a yellow solid B-2 (8.33 g) in 86.5% yield.The physical characterization data of B-2 were as follows: liquid chromatography-mass spectrometry (LCMS) (electrospray ionization, ESI): calculated value of C7H4FIN2, 261.9; measured value of [M + H]+ = 262.9. | | References | [1] Patent: WO2014/26328, 2014, A1. Location in patent: Page/Page column 43-44
[2] Patent: WO2014/28597, 2014, A2. Location in patent: Page/Page column 59
[3] Patent: US2015/191434, 2015, A1. Location in patent: Paragraph 0309
[4] Patent: WO2015/25025, 2015, A1. Location in patent: Page/Page column 184
[5] Patent: WO2014/28591, 2014, A2. Location in patent: Page/Page column 42-43 |
| | 4-Fluoro-3-iodo-1H-indazole Preparation Products And Raw materials |
|