|
|
| | 2,3,4,5-Tetrafluoronitrobenzene Basic information |
| Product Name: | 2,3,4,5-Tetrafluoronitrobenzene | | Synonyms: | 2,3,4,5-Tetrafluoronitrobenzene 99%;2,3,4,5-Tetrafluoronitrobenzene99%;2,3,4,5-Tetrafluoro-1-nitrobenzene;5-Nitro-1,2,3,4-tetrafluorobenzene;NSC 96618;2,3,4,5-Tetrafluoronitrobenzene, 98.5%;Benzene, 1,2,3,4-tetrafluoro-5-nitro-;1,2,3,4-Tetrafluoro-5-nitrobenzene | | CAS: | 5580-79-0 | | MF: | C6HF4NO2 | | MW: | 195.07 | | EINECS: | 226-972-8 | | Product Categories: | Aromatic Halides (substituted);Nitro Compounds;Nitrogen Compounds;Organic Building Blocks;Aromatics;Miscellaneous Reagents | | Mol File: | 5580-79-0.mol |  |
| | 2,3,4,5-Tetrafluoronitrobenzene Chemical Properties |
| Boiling point | 80 °C/24 mmHg (lit.) | | density | 1.618 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.473(lit.) | | Fp | 178 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform | | form | Oil | | Specific Gravity | 1.618 | | color | Clear Pale Yellow | | InChI | 1S/C6HF4NO2/c7-2-1-3(11(12)13)5(9)6(10)4(2)8/h1H | | InChIKey | MKMDVNZEIQDZEP-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(F)c(F)c(F)c1F | | CAS DataBase Reference | 5580-79-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29049090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3,4,5-Tetrafluoronitrobenzene Usage And Synthesis |
| Chemical Properties | clear yellow liquid | | Uses | 2,3,4,5-Tetrafluoronitrobenzene (cas# 5580-79-0) is a compound useful in organic synthesis. | | General Description | 2,3,4,5-Tetrafluoronitrobenzene is a polyfluoroarene. Mercuration of 2,3,4,5-tetrafluoronitrobenzene has been reported. It reacts with thioureas to afford para substituted diaryl sulphides. The nucleophilic aromatic substitution reactions of 2,3,4,5-tetrafluoronitrobenzene with methanol has been reported. |
| | 2,3,4,5-Tetrafluoronitrobenzene Preparation Products And Raw materials |
|