|
|
| | Methyltriphenylphosphonium iodide Basic information |
| | Methyltriphenylphosphonium iodide Chemical Properties |
| Melting point | 183-185 °C(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Powder | | color | White to light yellow | | Water Solubility | SOLUBLE | | Sensitive | Light Sensitive & Hygroscopic | | InChI | InChI=1S/C19H18P.HI/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H/q+1;/p-1 | | InChIKey | JNMIXMFEVJHFNY-UHFFFAOYSA-M | | SMILES | [P+](C)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1.[I-] | | CAS DataBase Reference | 2065-66-9(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-25 | | Safety Statements | 26-36-45-37/39-28A | | RIDADR | UN3464 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Methyltriphenylphosphonium iodide Usage And Synthesis |
| Chemical Properties | WHITE TO LIGHT YELLOW POWDER | | Uses | suzuki reaction | | Uses | Methyltriphenylphosphonium iodide is as a reactant for synthesis of triphenylamine-based dyes and polyolefinic aromatic molecules with pyrene for use in dye-sensitized solar cells. Used as ligand in coupling reaction. It is also used as a precursor to a Wittig reagent. | | Preparation | Methyltriphenylphosphonium iodide was prepared by the following procedure. Triphenylphosphine was recrystallized from ethanol and dried over phosphorus pentoxide under reduced pressure for 12 hr. A solution of 39 g (0.15 mol) of triphenylphosphine and 10.0 mL (22.8 g, 0.16 mol) of iodomethane in 105 mL of benzene was allowed to stir at room temperature for 12 hr. The precipitate was filtered, washed with benzene, and dried over phosphorus pentoxide under reduced pressure for 12 hr. The yield was 57 g (94%), mp 189°C (lit.2 mp 182°C). | | reaction suitability | reaction type: C-C Bond Formation |
| | Methyltriphenylphosphonium iodide Preparation Products And Raw materials |
|