- Salvianolic acid B
-
-
2026-06-30
- CAS:115939-25-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
|
| | Salvianolic acid B Basic information |
| Product Name: | Salvianolic acid B | | Synonyms: | Salvianolic acid B, 98%, from Salvia miltiorrhiza Bge.;2-((2S,3S)-4-((E)-3-((R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy)-3-oxoprop-1-enyl)-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydrobenzofuran-3-carbonyloxy)-3-(3,4-dihydroxyphenyl)propanoic acid;SALVIANOLIC ACID B(P);[DISCONTINUED]ReplacedbyKIT-00019545-010;[2R-[2a,3b-(R*),4[E(R*)]]]-3-Benzofurancarboxylic acid;4-[3-[1-carboxy-2-(3,4-dihydroxy-phenyl) ethoxy]-3-oxo-1-propenyl]-2-(3,4-dihydrophenyl)-2,3-dihydro-7-hydroxyl-3-[1-carboxy-2-(3,4-dihydroxyphenyl) ethyl] ester;(2R)-2-[(E)-3-[(2R,3R)-3-[[1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]-oxomethyl]-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydrobenzofuran-4-yl]-1-oxoprop-2-enoxy]-3-(3,4-dihydroxyphenyl)propanoic acid;Salvianolic acid B 115939-25-8 | | CAS: | 115939-25-8 | | MF: | C36H30O16 | | MW: | 718.61 | | EINECS: | 200-001-8 | | Product Categories: | Herb extract;chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Inhibitors;Miscellaneous | | Mol File: | 115939-25-8.mol |  |
| | Salvianolic acid B Chemical Properties |
| Melting point | >149oC (dec.) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Yellow to Yellow | | biological source | plant | | Water Solubility | water: soluble | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChIKey | SNKFFCBZYFGCQN-UXMWXTSRNA-N | | SMILES | [C@@H]1(C(=O)O[C@H](CC2C=CC(O)=C(O)C=2)C(O)=O)C2C(=CC=C(O)C=2O[C@H]1C1=CC=C(O)C(O)=C1)/C=C/C(=O)O[C@H](CC1=CC=C(O)C(O)=C1)C(O)=O |&1:0,4,25,39,r| | | LogP | 2.140 (est) |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | Salvianolic acid B Usage And Synthesis |
| Chemical Properties | Light yellow to light brown powder | | Uses | Salvianolic acid A (Sal A) and salvianolic acid B (Sal B) were isolated and purified from the crude extract of Salvia miltiorrhiza. Antioxidant activities of Sal A and Sal B were also evaluated and the ABTS results showed that Sal A and Sal B exhibited high total antioxidant activities, their EC50 values were 1.35 0.00 and 1.43 0.01 .mu.g/mL. This compound always contains a significant amount of residual solvent. | | Biological Activity | According to the existing research, Salvianolic acid B plays potential role in modulating inflammation, cell signaling, and immune responses by inhibiting the expression of COX, ERK, TNF-α, NO.', 'Salvianolic acid B has anti-obesity, antiviral (COVID-19) and free radical scavenging activity. |
| | Salvianolic acid B Preparation Products And Raw materials |
|