5-IAF manufacturers
- 5-IAF
-
- $31.00 / 1mg
-
2026-01-14
- CAS:63368-54-7
- Min. Order:
- Purity:
- Supply Ability: 10g
- 5-IAF
-
- $31.00 / 1mg
-
2026-01-14
- CAS:63368-54-7
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| Product Name: | 5-IAF | | Synonyms: | IAF;5-(IODOACETAMIDO)FLUORESCEIN, FOR FLUORE SCENCE;Fluorescein-5-iodoacetamide;4-(iodoacetamido)fluorescein;N-(3',6'-dihydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthen]-5-yl)-2-iodoacetaMide;5-IAF [5-IodoacetaMidofluorescein];5-IAF [5-Iodoacetamidofluorescein] *CAS 63368-54-7*;5-IAF | | CAS: | 63368-54-7 | | MF: | C22H14INO6 | | MW: | 515.25 | | EINECS: | | | Product Categories: | marker | | Mol File: | 63368-54-7.mol |  |
| | 5-IAF Chemical Properties |
| Melting point | 265-267 °C (dec.)(lit.) | | Boiling point | 788.4±60.0 °C(Predicted) | | density | 1.95±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:3): 0.25 mg/ml; Ethanol: 500μg/ml | | pka | 9.32±0.20(Predicted) | | form | A crystalline solid | | color | Light yellow to orange | | Appearance | Solid Powder | | BRN | 6543244 | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C22H14INO6/c23-10-20(27)24-11-1-4-15-14(7-11)21(28)30-22(15)16-5-2-12(25)8-18(16)29-19-9-13(26)3-6-17(19)22/h1-9,25-26H,10H2,(H,24,27) | | InChIKey | UATCLPJEZJKNHE-UHFFFAOYSA-N | | SMILES | Oc1ccc2c(Oc3cc(O)ccc3C24OC(=O)c5cc(NC(=O)CI)ccc45)c1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8 | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids |
| | 5-IAF Usage And Synthesis |
| Description | 5-(Iodoacetamido)fluorescein is a thiol-reactive fluorescent probe used for preparation of green-fluorescent thiol conjugates of biomolecules. | | Chemical Properties | Off-white to yellow solid | | Uses | 5-(Iodoacetamido)fluorescein is a thiol reactive fluorescein derivative. |
| | 5-IAF Preparation Products And Raw materials |
|