- Methoxy-PMS
-
- $30.00 / 10mg
-
2026-01-05
- CAS:65162-13-2
- Min. Order:
- Purity: 99.33%
- Supply Ability: 10g
|
| | 1-Methoxy-5-methylphenazinium methyl sulfate Basic information |
| Product Name: | 1-Methoxy-5-methylphenazinium methyl sulfate | | Synonyms: | N-METHYL METHOXYPHENAZINE-METHOSULFATE;1-METHOXY-5-METHYLPHENAZINE METHOSULFATE;1-METHOXY-5-METHYLPHENAZINIUM METHYL SULFATE;1-METHOXYPHENAZINE METHOSULFATE;1-METHOXY PMS;1-methoxy-5-methyl-phenaziniumethylsulfate;1-Methoxy PMS N-Methyl methoxyphenazinemethosulfate;1-methoxy-5-methylphenazinium methyl sulphate | | CAS: | 65162-13-2 | | MF: | C15H16N2O5S | | MW: | 336.36 | | EINECS: | 265-579-6 | | Product Categories: | | | Mol File: | 65162-13-2.mol |  |
| | 1-Methoxy-5-methylphenazinium methyl sulfate Chemical Properties |
| Melting point | 172 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Water: 1 mg/ml | | form | powder to crystal | | color | Orange to Brown to Dark purple | | Water Solubility | H2O: 1mg/mL, clear, red | | InChI | InChI=1S/C14H13N2O.CH4O4S/c1-16-11-7-4-3-6-10(11)15-14-12(16)8-5-9-13(14)17-2;1-5-6(2,3)4/h3-9H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 | | InChIKey | MASUWVVNWALEEM-UHFFFAOYSA-M | | SMILES | S([O-])(=O)(=O)OC.O(C1=CC=CC2=[N+](C3=CC=CC=C3N=C12)C)C | | CAS DataBase Reference | 65162-13-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/38-40 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933.99.8290 |
| | 1-Methoxy-5-methylphenazinium methyl sulfate Usage And Synthesis |
| Uses |
1-Methoxy-5-methylphenazinium methyl sulfate (PMS) has a redox potential of +63 mV. PMS is often used as an electron carrier for NADH tetrazolium and is a useful reagent for NAD(P)H-tetrazolium-based analytical systems. It is mainly used in the cytotoxic proliferation reagent CCK-8 experiment.
| | Mechanism of action | 1-Methoxy-5-methylphenazinium methyl sulfate contains WST-8 [chemical name: 2-(2-methoxy-4-nitrophenyl)-3-(4-nitrophenyl)-5-(2,4-disulfonic acid benzene)-2H-tetrazolyl monosodium salt], which is reduced to a highly water-soluble yellow formazan dye by dehydrogenase in cells under the action of the electron carrier 1-methoxy-5-methylphenazinium dimethyl sulfate. The amount of formazan generated is proportional to the number of living cells. Therefore, this property can directly analyze cell proliferation and toxicity. The main uses of this reagent are drug screening, cell proliferation assay, cytotoxicity assay, and tumour drug sensitivity test. |
| | 1-Methoxy-5-methylphenazinium methyl sulfate Preparation Products And Raw materials |
|