1,2,3,4-TETRAHYDRO-2-NAPHTHOIC ACID manufacturers
|
| | 1,2,3,4-TETRAHYDRO-2-NAPHTHOIC ACID Basic information |
| Product Name: | 1,2,3,4-TETRAHYDRO-2-NAPHTHOIC ACID | | Synonyms: | 1,2,3,4-Tetrahydro-2-naphthoic acid,98%;1,2,3,4-Tetrahydro-2-naphthoic acid,Tetralin-2-carboxylic acid;(RS)-1,2,3,4-Tetrahydronaphthalene-2-carboxylic acid;2-Carboxy-1,2,3,4-tetrahydronaphthalene;NSC 408608;1,2,3,4-Tetrahydro-2-naphthoic acid 98%;1,2,3,4-TETRAHYDRO-2-NAPHTHALENECARBOXYLIC ACID;1,2,3,4-TETRAHYDRO-2-NAPHTHOIC ACID | | CAS: | 53440-12-3 | | MF: | C11H12O2 | | MW: | 176.21 | | EINECS: | 258-553-0 | | Product Categories: | | | Mol File: | 53440-12-3.mol |  |
| | 1,2,3,4-TETRAHYDRO-2-NAPHTHOIC ACID Chemical Properties |
| Melting point | 93-96 °C (lit.) | | Boiling point | 267.83°C (rough estimate) | | density | 1.0558 (rough estimate) | | refractive index | 1.5425 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | pka | 4.57±0.20(Predicted) | | Appearance | White to off-white Solid | | BRN | 2050435 | | InChI | InChI=1S/C11H12O2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7H2,(H,12,13) | | InChIKey | NTAGXJQHJQUOOA-UHFFFAOYSA-N | | SMILES | C1C2=C(C=CC=C2)CCC1C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2,3,4-TETRAHYDRO-2-NAPHTHOIC ACID Usage And Synthesis |
| Uses | 1,2,3,4-Tetrahydro-2-naphthoic Acid is used as a reagent in organic synthesis of several compounds including that of N-acyl-5-methyl-3(2H)-isoxazolone derivatives which show high potential as fungicides. |
| | 1,2,3,4-TETRAHYDRO-2-NAPHTHOIC ACID Preparation Products And Raw materials |
|