|
|
| | 2-BROMO-1H-BENZIMIDAZOLE Basic information |
| | 2-BROMO-1H-BENZIMIDAZOLE Chemical Properties |
| Melting point | 191-196 °C | | Boiling point | 346.0±25.0 °C(Predicted) | | density | 1.770±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | form | Solid | | pka | 9.81±0.10(Predicted) | | color | White to Off-White | | Water Solubility | Insoluble in water. | | λmax | 280nm(lit.) | | InChI | InChI=1S/C7H5BrN2/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10) | | InChIKey | PHPYXVIHDRDPDI-UHFFFAOYSA-N | | SMILES | C1(Br)NC2=CC=CC=C2N=1 | | CAS DataBase Reference | 54624-57-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-41-37/38-22 | | Safety Statements | 26-36/37/39-39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 2-BROMO-1H-BENZIMIDAZOLE Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | Reactant in the synthesis of substituted benzimidazoles. 2-Bromobenzimidazole is the starting compound in the synthesis of polyhalogenobenzimidazoles. | | Uses | 2-Bromo-1H-benzimidazole is a 2-bromo substituted benzimidazole used in the preparation of benzimidazole nucleosides as antiviral agents. |
| | 2-BROMO-1H-BENZIMIDAZOLE Preparation Products And Raw materials |
|