|
|
| | Ethyl 1,5-diphenyl-1H-pyrazole-4-carboxylate Basic information |
| Product Name: | Ethyl 1,5-diphenyl-1H-pyrazole-4-carboxylate | | Synonyms: | BUTTPARK 146\04-44;1,5-Diphenyl-1H-pyrazole-4-carboxylic acid ethyl ester;JR-13453, Ethyl 1,5-diphenyl-1H-pyrazole-4-carboxylate, 95%;1H-Pyrazole-4-carboxylic acid, 1,5-diphenyl-, ethyl ester;1,5-Diphenyl-1H-pyrazole-4-carboxylic acid ethyl ester,97%;Ethyl 1,5-diphenyl-1H-pyrazole-4-carboxylate;Ethyl 1,5-diphenyl-1H-pyrazole-4-carboxylate | | CAS: | 53561-07-2 | | MF: | C18H16N2O2 | | MW: | 292.33 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Ethyl 1,5-diphenyl-1H-pyrazole-4-carboxylate Chemical Properties |
| form | solid | | InChI | 1S/C18H16N2O2/c1-2-22-18(21)16-13-19-20(15-11-7-4-8-12-15)17(16)14-9-5-3-6-10-14/h3-13H,2H2,1H3 | | InChIKey | DNBJQDUHQJKJCR-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1-c3ccccc3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 1,5-diphenyl-1H-pyrazole-4-carboxylate Usage And Synthesis |
| | Ethyl 1,5-diphenyl-1H-pyrazole-4-carboxylate Preparation Products And Raw materials |
|