|
|
| | N-(1-Phenethyl-piperidin-4-yl)-N-phenyl-acetamide Basic information |
| | N-(1-Phenethyl-piperidin-4-yl)-N-phenyl-acetamide Chemical Properties |
| Melting point | 93-95C | | Boiling point | 453.8±38.0 °C(Predicted) | | density | 1.100±0.06 g/cm3(Predicted) | | Fp | 9℃ | | storage temp. | Controlled Substance, -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 8.92±0.10(Predicted) | | form | Solid | | color | Off-White | | Major Application | forensics and toxicology | | InChI | 1S/C21H26N2O/c1-18(24)23(20-10-6-3-7-11-20)21-13-16-22(17-14-21)15-12-19-8-4-2-5-9-19/h2-11,21H,12-17H2,1H3 | | InChIKey | FYIUUQUPOKIKNI-UHFFFAOYSA-N | | SMILES | O=C(C)N(C1CCN(CCC2=CC=CC=C2)CC1)C3=CC=CC=C3 |
| Hazard Codes | Xn,Xi,T,F | | Risk Statements | 22-36/37/38-39/23/24/25-23/24/25-11 | | Safety Statements | 26-45-36/37-16-7 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | HS Code | 2933399090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 | | DEA Controlled Substances | CSCN: 9821 CSA SCH: Schedule I NARC: Yes |
| | N-(1-Phenethyl-piperidin-4-yl)-N-phenyl-acetamide Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A Fentanyl analog.
Controlled Substance | | General Description | A certified Snap-N-Spike solution suitable for use as starting material in calibrators and controls for fentanyl LC/MS or GC/MS testing methods in clinical toxicology, urine drug testing, prescription monitoring, or forensic analysis applications. Acetyl fentanyl is a designer drug and fentanyl analog with a potency 40 times greater than heroin and 80 times greater than morphine. This Certified Spiking Solution is supplied in a convenient, quantitative, US DEA-exempt solution format and with TK #s for Canadian customers. |
| | N-(1-Phenethyl-piperidin-4-yl)-N-phenyl-acetamide Preparation Products And Raw materials |
|